1-(2,4-Bis-trifluoromethyl-benzyl)-5,6-dichloro-2-piperidin-4-yl-1H-benzoimidazole

ID: ALA351603

PubChem CID: 44375264

Max Phase: Preclinical

Molecular Formula: C21H17Cl2F6N3

Molecular Weight: 496.28

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  FC(F)(F)c1ccc(Cn2c(C3CCNCC3)nc3cc(Cl)c(Cl)cc32)c(C(F)(F)F)c1

Standard InChI:  InChI=1S/C21H17Cl2F6N3/c22-15-8-17-18(9-16(15)23)32(19(31-17)11-3-5-30-6-4-11)10-12-1-2-13(20(24,25)26)7-14(12)21(27,28)29/h1-2,7-9,11,30H,3-6,10H2

Standard InChI Key:  JKZJGSLVTMJKDI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.4292   -1.8625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9167   -1.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4292   -0.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500   -0.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6875   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3792   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4792   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9375   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1292   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9375   -0.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8292   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0292   -4.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -1.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167   -0.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7417   -1.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3917   -1.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3292   -3.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7750   -3.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0000   -4.4042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042   -5.0292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.3750   -3.4167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -4.5250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.0917   -5.6250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -5.6792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -2.0167    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -0.3625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.0125   -0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9542   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1875   -0.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1250   -1.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  1  1  0
  5  4  1  0
  6  8  1  0
  7  1  1  0
  8 11  2  0
  9 14  1  0
 10  4  2  0
 11  7  1  0
 12  5  2  0
 13  8  1  0
 14 20  1  0
 15 10  1  0
 16 15  2  0
 17  2  1  0
 18 30  1  0
 19 11  1  0
 20 19  2  0
 21  6  1  0
 22  6  1  0
 23  6  1  0
 24  9  1  0
 25  9  1  0
 26  9  1  0
 27 15  1  0
 28 16  1  0
 29 31  1  0
 30 32  1  0
 31 17  1  0
 32 17  1  0
  5  3  1  0
 16 12  1  0
 29 18  1  0
 13 14  2  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.28Molecular Weight (Monoisotopic): 495.0704AlogP: 6.90#Rotatable Bonds: 3
Polar Surface Area: 29.85Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.01CX LogP: 6.40CX LogD: 3.88
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -1.23

References

1. He Y, Yang J, Wu B, Robinson D, Sprankle K, Kung PP, Lowery K, Mohan V, Hofstadler S, Swayze EE, Griffey R..  (2004)  Synthesis and evaluation of novel bacterial rRNA-binding benzimidazoles by mass spectrometry.,  14  (3): [PMID:14741271] [10.1016/j.bmcl.2003.11.031]

Source