The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2,4-Bis-trifluoromethyl-benzyl)-5,6-dichloro-2-piperidin-4-yl-1H-benzoimidazole ID: ALA351603
PubChem CID: 44375264
Max Phase: Preclinical
Molecular Formula: C21H17Cl2F6N3
Molecular Weight: 496.28
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)c1ccc(Cn2c(C3CCNCC3)nc3cc(Cl)c(Cl)cc32)c(C(F)(F)F)c1
Standard InChI: InChI=1S/C21H17Cl2F6N3/c22-15-8-17-18(9-16(15)23)32(19(31-17)11-3-5-30-6-4-11)10-12-1-2-13(20(24,25)26)7-14(12)21(27,28)29/h1-2,7-9,11,30H,3-6,10H2
Standard InChI Key: JKZJGSLVTMJKDI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
5.4292 -1.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9167 -1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -0.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6500 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6500 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1917 -4.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6875 -2.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3792 -4.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4792 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9375 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1292 -3.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9375 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -4.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2167 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2167 -0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7417 -1.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3917 -1.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3292 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7750 -3.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0000 -4.4042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -5.0292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3750 -3.4167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -4.5250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.0917 -5.6250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.9292 -5.6792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 -2.0167 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 -0.3625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.0125 -0.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9542 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1875 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1250 -1.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 4 1 0
6 8 1 0
7 1 1 0
8 11 2 0
9 14 1 0
10 4 2 0
11 7 1 0
12 5 2 0
13 8 1 0
14 20 1 0
15 10 1 0
16 15 2 0
17 2 1 0
18 30 1 0
19 11 1 0
20 19 2 0
21 6 1 0
22 6 1 0
23 6 1 0
24 9 1 0
25 9 1 0
26 9 1 0
27 15 1 0
28 16 1 0
29 31 1 0
30 32 1 0
31 17 1 0
32 17 1 0
5 3 1 0
16 12 1 0
29 18 1 0
13 14 2 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.28Molecular Weight (Monoisotopic): 495.0704AlogP: 6.90#Rotatable Bonds: 3Polar Surface Area: 29.85Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.01CX LogP: 6.40CX LogD: 3.88Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -1.23
References 1. He Y, Yang J, Wu B, Robinson D, Sprankle K, Kung PP, Lowery K, Mohan V, Hofstadler S, Swayze EE, Griffey R.. (2004) Synthesis and evaluation of novel bacterial rRNA-binding benzimidazoles by mass spectrometry., 14 (3): [PMID:14741271 ] [10.1016/j.bmcl.2003.11.031 ]