The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,Z)-2-(1,3-dioxoisoindolin-2-yl)-N'-(4-methoxybenzylidene)-3-phenylpropanehydrazide ID: ALA3580858
PubChem CID: 122178481
Max Phase: Preclinical
Molecular Formula: C25H21N3O4
Molecular Weight: 427.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=N\NC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)cc1
Standard InChI: InChI=1S/C25H21N3O4/c1-32-19-13-11-18(12-14-19)16-26-27-23(29)22(15-17-7-3-2-4-8-17)28-24(30)20-9-5-6-10-21(20)25(28)31/h2-14,16,22H,15H2,1H3,(H,27,29)/b26-16-/t22-/m0/s1
Standard InChI Key: OSTPAQYMQBRJON-PPEIKGMUSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0871 0.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0825 2.3453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -2.3426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8205 1.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0204 1.3619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8536 -1.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0540 2.6369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7874 3.9463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0209 5.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5202 5.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7522 6.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2524 6.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4796 5.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 3.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7881 3.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1202 -2.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8844 -3.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1488 -5.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6489 -5.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8846 -3.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6202 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9802 5.1537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5643 4.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 1 0
9 11 2 0
7 12 2 0
10 13 1 0
13 14 2 0
10 15 1 6
13 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
15 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
22 31 1 0
31 32 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.46Molecular Weight (Monoisotopic): 427.1532AlogP: 3.05#Rotatable Bonds: 7Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.48CX Basic pKa: 1.69CX LogP: 3.79CX LogD: 3.79Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.00
References 1. Coelho LCD, Cardoso MVdO, Moreira DRM, Gomes PATdM, Cavalcanti SMT, Oliveira AR, Filho GBdO, Siqueira LRPd, Barbosa MdO, Borba EFdO, Silva TGd, Kaskow B, Karimi M, Abraham LJ, Leite ACL. (2014) Novel phthalimide derivatives with TNF- and IL-1 expression inhibitory and apoptotic inducing properties, 5 (6): [10.1039/C4MD00070F ]