4-hydroxybenzyl-beta-D-glucopyranoside

ID: ALA3609099

PubChem CID: 49871127

Max Phase: Preclinical

Molecular Formula: C13H18O7

Molecular Weight: 286.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OC[C@H]1O[C@@H](OCc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C13H18O7/c14-5-9-10(16)11(17)12(18)13(20-9)19-6-7-1-3-8(15)4-2-7/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1

Standard InChI Key:  WGBHVCJJFIVFAL-UJPOAAIJSA-N

Molfile:  

     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
    0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6387    0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003    1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6061   -7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6060   -6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3071   -8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3071   -9.4503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6 12  1  0
 11  5  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  1
  7  1  1  1
  8  2  1  6
  9  3  1  1
 10  4  1  6
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
 15 20  1  0
 20  1  1  0
M  END

Alternative Forms

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 286.28Molecular Weight (Monoisotopic): 286.1053AlogP: -1.29#Rotatable Bonds: 4
Polar Surface Area: 119.61Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.48CX Basic pKa: CX LogP: -0.87CX LogD: -0.87
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.47Np Likeness Score: 1.82

References

1. Gođevac D, Stanković J, Novaković M, Anđelković B, Dajić-Stevanović Z, Petrović M, Stanković M..  (2015)  Phenolic Compounds from Atriplex littoralis and Their Radiation-Mitigating Activity.,  78  (9): [PMID:26290401] [10.1021/acs.jnatprod.5b00273]

Source