The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-tert-Butoxy-2-{2-[(2-pyridin-3-yl-thiazole-4-carbonyl)-amino]-acryloylamino}-propionic acid methyl ester ID: ALA365979
PubChem CID: 44400764
Max Phase: Preclinical
Molecular Formula: C20H24N4O5S
Molecular Weight: 432.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(NC(=O)c1csc(-c2cccnc2)n1)C(=O)N[C@@H](COC(C)(C)C)C(=O)OC
Standard InChI: InChI=1S/C20H24N4O5S/c1-12(16(25)23-14(19(27)28-5)10-29-20(2,3)4)22-17(26)15-11-30-18(24-15)13-7-6-8-21-9-13/h6-9,11,14H,1,10H2,2-5H3,(H,22,26)(H,23,25)/t14-/m0/s1
Standard InChI Key: WKYYKPFHEJPCNY-AWEZNQCLSA-N
Molfile:
RDKit 2D
30 31 0 0 1 0 0 0 0 0999 V2000
2.9792 0.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2250 0.9083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6667 0.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7000 0.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 0.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 -0.4292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1375 0.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 0.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 0.9833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4167 0.5708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8917 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8542 0.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0042 0.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7000 1.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 -0.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 1.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4500 -0.2042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1375 1.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0042 -0.6750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0042 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3667 -0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7167 0.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5167 1.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7875 0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5917 -0.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7167 -1.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 -1.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4292 0.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3000 1.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 7 1 0
6 11 1 0
7 10 1 0
8 9 1 0
9 5 1 0
10 4 1 0
11 1 2 0
12 3 1 0
13 8 1 0
14 4 2 0
15 5 2 0
8 16 1 6
17 13 2 0
18 22 2 0
19 7 2 0
20 16 1 0
21 20 1 0
22 12 1 0
23 13 1 0
24 12 2 0
25 30 2 0
26 21 1 0
27 21 1 0
28 21 1 0
29 23 1 0
30 24 1 0
6 3 1 0
25 18 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.50Molecular Weight (Monoisotopic): 432.1467AlogP: 1.92#Rotatable Bonds: 8Polar Surface Area: 119.51Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.60CX Basic pKa: 3.99CX LogP: 1.16CX LogD: 1.16Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -1.05
References 1. Ayida BK, Simonsen KB, Vourloumis D, Hermann T.. (2005) Synthesis of dehydroalanine fragments as thiostrepton side chain mimetics., 15 (10): [PMID:15863296 ] [10.1016/j.bmcl.2005.03.084 ]