The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Glutathionyl cyclophosphamide ID: ALA3706539
Cas Number: 77273-67-7
PubChem CID: 71317120
Max Phase: Preclinical
Molecular Formula: C17H30Cl2N5O8PS
Molecular Weight: 566.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)N[C@@H](CSC1CCOP(=O)(N(CCCl)CCCl)N1)C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C17H30Cl2N5O8PS/c18-4-6-24(7-5-19)33(31)23-14(3-8-32-33)34-10-12(16(28)21-9-15(26)27)22-13(25)2-1-11(20)17(29)30/h11-12,14H,1-10,20H2,(H,21,28)(H,22,25)(H,23,31)(H,26,27)(H,29,30)/t11-,12-,14?,33?/m0/s1
Standard InChI Key: CXEDBYAXQXFDHD-XNZWOTSQSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2999 2.2084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0536 2.0744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6000 1.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3029 3.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6036 4.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6060 5.6579 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8999 2.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9394 1.6091 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4431 -10.3638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7798 -11.7187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8218 -9.9205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2297 -5.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2321 -3.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1933 -1.5053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4928 -0.7545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4933 0.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5324 1.3466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4541 1.3463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
6 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 0
3 8 2 0
7 9 1 0
7 10 1 0
10 11 1 0
11 12 1 0
9 13 1 0
13 14 1 0
16 15 1 1
17 16 1 0
16 20 1 0
17 18 2 0
17 19 1 0
20 21 1 0
22 21 1 0
22 23 2 0
22 24 1 0
25 24 1 1
26 25 1 0
25 28 1 0
26 27 2 0
26 30 1 0
28 29 1 0
31 30 1 0
32 31 1 0
32 33 2 0
32 34 1 0
1 29 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.40Molecular Weight (Monoisotopic): 565.0930AlogP: -0.18#Rotatable Bonds: 16Polar Surface Area: 200.39Molecular Species: ZWITTERIONHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.80CX Basic pKa: 9.31CX LogP: -4.40CX LogD: -7.56Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.11Np Likeness Score: 0.32
References 1. Zhong S, Huang M, Yang X, Liang L, Wang Y, Romkes M, Duan W, Chan E, Zhou SF.. (2006) Relationship of glutathione S-transferase genotypes with side-effects of pulsed cyclophosphamide therapy in patients with systemic lupus erythematosus., 62 (4): [PMID:16995867 ] [10.1111/j.1365-2125.2006.02690.x ]