The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Phosphamide mustard conjugate ID: ALA3706541
Cas Number: 145784-68-5
PubChem CID: 71316088
Max Phase: Preclinical
Molecular Formula: C24H43N8O14PS2
Molecular Weight: 762.76
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](CCC(=O)N[C@@H](CSCCN(CCSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)P(N)(=O)O)C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C24H43N8O14PS2/c25-13(23(41)42)1-3-17(33)30-15(21(39)28-9-19(35)36)11-48-7-5-32(47(27,45)46)6-8-49-12-16(22(40)29-10-20(37)38)31-18(34)4-2-14(26)24(43)44/h13-16H,1-12,25-26H2,(H,28,39)(H,29,40)(H,30,33)(H,31,34)(H,35,36)(H,37,38)(H,41,42)(H,43,44)(H3,27,45,46)/t13-,14-,15-,16-/m0/s1
Standard InChI Key: UVGSFFNNXIWBSA-VGWMRTNUSA-N
Molfile:
RDKit 2D
49 48 0 0 0 0 0 0 0 0999 V2000
15.5968 -1.5008 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.5567 -2.0994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5949 -2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6350 -2.1026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5999 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -1.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2606 0.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1030 2.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0648 2.8526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6999 0.7500 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4038 2.9994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4069 4.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7077 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7102 6.4488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7459 4.6470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5998 -1.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9392 0.1503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8998 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6998 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3998 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0967 2.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1349 2.8526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4998 0.7500 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.7959 2.9994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7928 4.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4920 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4895 6.4488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4538 4.6470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 8 1 0
1 5 1 0
8 9 1 0
1 3 1 0
5 6 1 0
1 2 2 0
6 7 1 0
1 4 1 0
11 12 1 6
11 15 1 0
12 13 2 0
12 14 1 0
15 16 1 0
17 16 1 0
17 18 2 0
17 19 1 0
20 19 1 6
21 20 1 0
20 23 1 0
21 22 2 0
21 25 1 0
23 24 1 0
26 25 1 0
27 26 1 0
27 28 2 0
27 29 1 0
24 7 1 0
11 10 1 0
31 30 1 1
32 31 1 0
31 35 1 0
32 33 2 0
32 34 1 0
35 36 1 0
37 36 1 0
37 38 2 0
37 39 1 0
40 39 1 1
41 40 1 0
40 43 1 0
41 42 2 0
41 45 1 0
43 44 1 0
46 45 1 0
47 46 1 0
47 48 2 0
47 49 1 0
9 44 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 762.76Molecular Weight (Monoisotopic): 762.2078AlogP: -4.43#Rotatable Bonds: 27Polar Surface Area: 384.20Molecular Species: ZWITTERIONHBA: 13HBD: 12#RO5 Violations: 3HBA (Lipinski): 22HBD (Lipinski): 15#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.51CX Basic pKa: 9.61CX LogP: -11.55CX LogD: -19.77Aromatic Rings: ┄Heavy Atoms: 49QED Weighted: 0.03Np Likeness Score: 0.13
References 1. Zhong S, Huang M, Yang X, Liang L, Wang Y, Romkes M, Duan W, Chan E, Zhou SF.. (2006) Relationship of glutathione S-transferase genotypes with side-effects of pulsed cyclophosphamide therapy in patients with systemic lupus erythematosus., 62 (4): [PMID:16995867 ] [10.1111/j.1365-2125.2006.02690.x ]