Phosphamide mustard conjugate

ID: ALA3706541

Cas Number: 145784-68-5

PubChem CID: 71316088

Max Phase: Preclinical

Molecular Formula: C24H43N8O14PS2

Molecular Weight: 762.76

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@@H](CCC(=O)N[C@@H](CSCCN(CCSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)P(N)(=O)O)C(=O)NCC(=O)O)C(=O)O

Standard InChI:  InChI=1S/C24H43N8O14PS2/c25-13(23(41)42)1-3-17(33)30-15(21(39)28-9-19(35)36)11-48-7-5-32(47(27,45)46)6-8-49-12-16(22(40)29-10-20(37)38)31-18(34)4-2-14(26)24(43)44/h13-16H,1-12,25-26H2,(H,28,39)(H,29,40)(H,30,33)(H,31,34)(H,35,36)(H,37,38)(H,41,42)(H,43,44)(H3,27,45,46)/t13-,14-,15-,16-/m0/s1

Standard InChI Key:  UVGSFFNNXIWBSA-VGWMRTNUSA-N

Molfile:  

     RDKit          2D

 49 48  0  0  0  0  0  0  0  0999 V2000
   15.5968   -1.5008    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   14.5567   -2.0994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5949   -2.7008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6350   -2.1026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5999    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000   -1.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3000    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2606    0.1503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3000    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9000    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5000    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5000    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7999    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1030    2.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0648    2.8526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6999    0.7500    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.4038    2.9994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4069    4.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7077    5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7102    6.4488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7459    4.6470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5998   -1.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9392    0.1503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8998    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6998    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3998    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0967    2.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1349    2.8526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4998    0.7500    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7959    2.9994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7928    4.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4920    5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4895    6.4488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4538    4.6470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  8  1  0
  1  5  1  0
  8  9  1  0
  1  3  1  0
  5  6  1  0
  1  2  2  0
  6  7  1  0
  1  4  1  0
 11 12  1  6
 11 15  1  0
 12 13  2  0
 12 14  1  0
 15 16  1  0
 17 16  1  0
 17 18  2  0
 17 19  1  0
 20 19  1  6
 21 20  1  0
 20 23  1  0
 21 22  2  0
 21 25  1  0
 23 24  1  0
 26 25  1  0
 27 26  1  0
 27 28  2  0
 27 29  1  0
 24  7  1  0
 11 10  1  0
 31 30  1  1
 32 31  1  0
 31 35  1  0
 32 33  2  0
 32 34  1  0
 35 36  1  0
 37 36  1  0
 37 38  2  0
 37 39  1  0
 40 39  1  1
 41 40  1  0
 40 43  1  0
 41 42  2  0
 41 45  1  0
 43 44  1  0
 46 45  1  0
 47 46  1  0
 47 48  2  0
 47 49  1  0
  9 44  1  0
M  END

Alternative Forms

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 762.76Molecular Weight (Monoisotopic): 762.2078AlogP: -4.43#Rotatable Bonds: 27
Polar Surface Area: 384.20Molecular Species: ZWITTERIONHBA: 13HBD: 12
#RO5 Violations: 3HBA (Lipinski): 22HBD (Lipinski): 15#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.51CX Basic pKa: 9.61CX LogP: -11.55CX LogD: -19.77
Aromatic Rings: Heavy Atoms: 49QED Weighted: 0.03Np Likeness Score: 0.13

References

1. Zhong S, Huang M, Yang X, Liang L, Wang Y, Romkes M, Duan W, Chan E, Zhou SF..  (2006)  Relationship of glutathione S-transferase genotypes with side-effects of pulsed cyclophosphamide therapy in patients with systemic lupus erythematosus.,  62  (4): [PMID:16995867] [10.1111/j.1365-2125.2006.02690.x]