2-[(2R,3R,6S)-3,5-Diamino-2-hydroxy-6-(7-trifluoromethyl-quinolin-4-ylsulfanylmethoxy)-cyclohexyloxy]-N-(3-dimethylamino-propyl)-acetamide

ID: ALA371237

PubChem CID: 44404595

Max Phase: Preclinical

Molecular Formula: C24H34F3N5O4S

Molecular Weight: 545.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCCNC(=O)COC1[C@@H](OCSc2ccnc3cc(C(F)(F)F)ccc23)C(N)C[C@@H](N)[C@H]1O

Standard InChI:  InChI=1S/C24H34F3N5O4S/c1-32(2)9-3-7-31-20(33)12-35-23-21(34)16(28)11-17(29)22(23)36-13-37-19-6-8-30-18-10-14(24(25,26)27)4-5-15(18)19/h4-6,8,10,16-17,21-23,34H,3,7,9,11-13,28-29H2,1-2H3,(H,31,33)/t16-,17?,21-,22+,23?/m1/s1

Standard InChI Key:  LEIVFBHDRDDCBP-LDPKQNHRSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  1  0  0  0  0  0999 V2000
    4.7500   -2.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6667   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0958    1.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3042   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167   -1.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8667   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8917   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1000   -0.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4458    0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4542   -2.8917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5583   -0.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9792    0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0125   -1.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3292    0.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -1.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -4.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6000    0.4458    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5833    1.7375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7375    1.6083    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042   -0.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -3.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2875   -0.6167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167   -0.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0167   -1.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6667   -2.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3500   -4.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6417   -2.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4167   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2042   -4.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7792   -4.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0667   -3.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4917   -3.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9250   -3.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2000   -5.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4 10  1  0
  5  2  1  0
  6  3  1  0
  7 16  1  0
  8  6  1  0
  9  7  1  0
 10 17  2  0
 11  1  1  0
 12  9  2  0
 13  7  2  0
 14 30  2  0
 15 24  1  0
 16 25  1  0
 17 13  1  0
 18 23  1  0
 19 15  2  0
 20  4  1  0
 21  4  1  0
 22  4  1  0
  3 23  1  1
 24 11  1  0
 25 18  1  0
 26  6  1  0
  5 27  1  1
  2 28  1  6
 29 15  1  0
 30 31  1  0
 31 16  2  0
 32 35  1  0
 33 34  1  0
 34 29  1  0
 35 33  1  0
 36 32  1  0
 37 32  1  0
  5  8  1  0
 14  9  1  0
 12 10  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.63Molecular Weight (Monoisotopic): 545.2284AlogP: 1.56#Rotatable Bonds: 11
Polar Surface Area: 135.96Molecular Species: BASEHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.52CX Basic pKa: 9.77CX LogP: 0.06CX LogD: -4.48
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.19Np Likeness Score: -0.69

References

1. Wang X, Migawa MT, Sannes-Lowery KA, Swayze EE..  (2005)  The synthesis and 16S A-site rRNA recognition of carbohydrate-free aminoglycosides.,  15  (22): [PMID:16168642] [10.1016/j.bmcl.2005.08.027]

Source