(1R,3S,6R)-4,6-Diamino-2-[2-(3-amino-propylamino)-ethoxy]-3-(7-trifluoromethyl-quinolin-4-ylsulfanylmethoxy)-cyclohexanol

ID: ALA371500

PubChem CID: 44404593

Max Phase: Preclinical

Molecular Formula: C22H32F3N5O3S

Molecular Weight: 503.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCCNCCOC1[C@@H](OCSc2ccnc3cc(C(F)(F)F)ccc23)C(N)C[C@@H](N)[C@H]1O

Standard InChI:  InChI=1S/C22H32F3N5O3S/c23-22(24,25)13-2-3-14-17(10-13)30-7-4-18(14)34-12-33-20-16(28)11-15(27)19(31)21(20)32-9-8-29-6-1-5-26/h2-4,7,10,15-16,19-21,29,31H,1,5-6,8-9,11-12,26-28H2/t15-,16?,19-,20+,21?/m1/s1

Standard InChI Key:  WYNYJAPRXMNOGA-ZNSMGHQKSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  1  0  0  0  0  0999 V2000
    3.1250   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7208    2.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -0.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792   -0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3917   -0.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7583    0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2667   -0.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5250    0.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0708    1.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1833    0.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6458    1.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6375   -0.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1083    0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2958    2.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3042   -0.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2250    1.5625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2083    2.8583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3625    2.7250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.0792    0.2458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6625    0.5083    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.8292   -1.7750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917   -0.4792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3917    0.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9833   -0.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2083   -0.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7250   -3.1542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5792   -3.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1542   -3.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4417   -2.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8667   -2.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0167   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0167   -1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 10  1  0
  4  1  1  0
  5  2  1  0
  6  4  1  0
  7 14  1  0
  8  6  1  0
  9  7  1  0
 10 15  2  0
 11  9  2  0
 12  7  2  0
 13 26  2  0
 14 21  1  0
 15 12  1  0
 16 20  1  0
 17  3  1  0
 18  3  1  0
 19  3  1  0
  4 20  1  1
 21 16  1  0
 22  1  1  0
  5 23  1  1
 24  6  1  0
  2 25  1  6
 26 27  1  0
 27 14  2  0
 28 33  1  0
 29 32  1  0
 30 31  1  0
 31 28  1  0
 32 30  1  0
 33 34  1  0
 34 22  1  0
  5  8  1  0
 13  9  1  0
 11 10  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.59Molecular Weight (Monoisotopic): 503.2178AlogP: 1.43#Rotatable Bonds: 11
Polar Surface Area: 141.67Molecular Species: BASEHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.53CX Basic pKa: 10.17CX LogP: -0.01CX LogD: -6.06
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -0.21

References

1. Wang X, Migawa MT, Sannes-Lowery KA, Swayze EE..  (2005)  The synthesis and 16S A-site rRNA recognition of carbohydrate-free aminoglycosides.,  15  (22): [PMID:16168642] [10.1016/j.bmcl.2005.08.027]

Source