The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,3S,6R)-4,6-Diamino-2-[2-(3-amino-propylamino)-ethoxy]-3-(7-trifluoromethyl-quinolin-4-ylsulfanylmethoxy)-cyclohexanol ID: ALA371500
PubChem CID: 44404593
Max Phase: Preclinical
Molecular Formula: C22H32F3N5O3S
Molecular Weight: 503.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NCCCNCCOC1[C@@H](OCSc2ccnc3cc(C(F)(F)F)ccc23)C(N)C[C@@H](N)[C@H]1O
Standard InChI: InChI=1S/C22H32F3N5O3S/c23-22(24,25)13-2-3-14-17(10-13)30-7-4-18(14)34-12-33-20-16(28)11-15(27)19(31)21(20)32-9-8-29-6-1-5-26/h2-4,7,10,15-16,19-21,29,31H,1,5-6,8-9,11-12,26-28H2/t15-,16?,19-,20+,21?/m1/s1
Standard InChI Key: WYNYJAPRXMNOGA-ZNSMGHQKSA-N
Molfile:
RDKit 2D
34 36 0 0 1 0 0 0 0 0999 V2000
3.1250 -1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -0.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7208 2.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7167 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -0.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -0.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7583 0.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2667 -0.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5250 0.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0708 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1833 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6458 1.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6375 -0.4417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1083 0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2958 2.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -0.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2250 1.5625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.2083 2.8583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.3625 2.7250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 0.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6625 0.5083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8292 -1.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -0.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 0.3208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9833 -0.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2083 -0.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7250 -3.1542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 -3.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -3.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4417 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -2.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -2.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -1.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 10 1 0
4 1 1 0
5 2 1 0
6 4 1 0
7 14 1 0
8 6 1 0
9 7 1 0
10 15 2 0
11 9 2 0
12 7 2 0
13 26 2 0
14 21 1 0
15 12 1 0
16 20 1 0
17 3 1 0
18 3 1 0
19 3 1 0
4 20 1 1
21 16 1 0
22 1 1 0
5 23 1 1
24 6 1 0
2 25 1 6
26 27 1 0
27 14 2 0
28 33 1 0
29 32 1 0
30 31 1 0
31 28 1 0
32 30 1 0
33 34 1 0
34 22 1 0
5 8 1 0
13 9 1 0
11 10 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.59Molecular Weight (Monoisotopic): 503.2178AlogP: 1.43#Rotatable Bonds: 11Polar Surface Area: 141.67Molecular Species: BASEHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.53CX Basic pKa: 10.17CX LogP: -0.01CX LogD: -6.06Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -0.21
References 1. Wang X, Migawa MT, Sannes-Lowery KA, Swayze EE.. (2005) The synthesis and 16S A-site rRNA recognition of carbohydrate-free aminoglycosides., 15 (22): [PMID:16168642 ] [10.1016/j.bmcl.2005.08.027 ]