5-(4-chlorophenyl)-2-(3-methoxy-3-oxopropanamido)-2,3-dihydro-1H-indene-2-carboxylic acid

ID: ALA3719254

PubChem CID: 127024378

Max Phase: Preclinical

Molecular Formula: C20H18ClNO5

Molecular Weight: 387.82

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)CC(=O)NC1(C(=O)O)Cc2ccc(-c3ccc(Cl)cc3)cc2C1

Standard InChI:  InChI=1S/C20H18ClNO5/c1-27-18(24)9-17(23)22-20(19(25)26)10-14-3-2-13(8-15(14)11-20)12-4-6-16(21)7-5-12/h2-8H,9-11H2,1H3,(H,22,23)(H,25,26)

Standard InChI Key:  CPAGCMZOWOMHJA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210   -3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184   -2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143   -0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2590   -3.5870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.3026    1.3234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5434    2.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2841    3.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3434    2.6094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5249    5.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3249    5.2093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2656    6.5232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6586    7.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3218   -1.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -2.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5217   -1.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 10  1  0
 13 16  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
  8 25  1  0
 25 26  1  0
 25 27  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3719254

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.82Molecular Weight (Monoisotopic): 387.0874AlogP: 2.61#Rotatable Bonds: 5
Polar Surface Area: 92.70Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.70CX Basic pKa: CX LogP: 3.30CX LogD: -0.01
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.61Np Likeness Score: -0.38

References

1.  (2010)  Regulating agent of GPR34 receptor function, 

Source