3-((S)-2-Methoxycarbonyl-2-{2-[(pyridine-2-carbonyl)-amino]-acryloylamino}-ethyl)-indole-1-carboxylic acid tert-butyl ester

ID: ALA372445

PubChem CID: 44400854

Max Phase: Preclinical

Molecular Formula: C26H28N4O6

Molecular Weight: 492.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(NC(=O)c1ccccn1)C(=O)N[C@@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)C(=O)OC

Standard InChI:  InChI=1S/C26H28N4O6/c1-16(28-23(32)19-11-8-9-13-27-19)22(31)29-20(24(33)35-5)14-17-15-30(25(34)36-26(2,3)4)21-12-7-6-10-18(17)21/h6-13,15,20H,1,14H2,2-5H3,(H,28,32)(H,29,31)/t20-/m0/s1

Standard InChI Key:  PWXSPADUYCYSHO-FQEVSTJZSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  1  0  0  0  0  0999 V2000
    8.7667   -5.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5792   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5792   -4.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3917   -4.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1875   -5.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5625   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4625   -5.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -3.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2792   -2.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0000   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0000   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7167   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8792   -6.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0917   -4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6917   -4.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5625   -4.2292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -2.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7042   -2.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7000   -6.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -2.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4250   -3.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2292   -6.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7792   -6.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9750   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9750   -2.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2167   -5.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5125   -6.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9917   -7.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1417   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5542   -7.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8250   -6.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2542   -4.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2542   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  2  0
  4  1  1  0
  5  1  1  0
  6 11  1  0
  7  5  2  0
  8  6  1  0
  9 10  1  0
 10  8  1  0
 11 12  1  0
 12 13  1  6
 13  3  1  0
 14 12  1  0
 15  2  1  0
 16  2  2  0
 17  9  1  0
 18 17  1  0
 19  6  2  0
 20  9  2  0
 21 14  2  0
 22 15  1  0
 23  8  2  0
 24 14  1  0
 25  5  1  0
 26  7  1  0
 27 18  2  0
 28 17  2  0
 29 22  1  0
 30 22  1  0
 31 22  1  0
 32 24  1  0
 33 25  2  0
 34 33  1  0
 35 36  2  0
 36 28  1  0
  7  3  1  0
 34 26  2  0
 35 27  1  0
M  END

Alternative Forms

  1. Parent:

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.53Molecular Weight (Monoisotopic): 492.2009AlogP: 2.96#Rotatable Bonds: 7
Polar Surface Area: 128.62Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.56CX Basic pKa: 1.97CX LogP: 2.58CX LogD: 2.58
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.67

References

1. Ayida BK, Simonsen KB, Vourloumis D, Hermann T..  (2005)  Synthesis of dehydroalanine fragments as thiostrepton side chain mimetics.,  15  (10): [PMID:15863296] [10.1016/j.bmcl.2005.03.084]

Source