The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((S)-2-Methoxycarbonyl-2-{2-[(pyridine-2-carbonyl)-amino]-acryloylamino}-ethyl)-indole-1-carboxylic acid tert-butyl ester ID: ALA372445
PubChem CID: 44400854
Max Phase: Preclinical
Molecular Formula: C26H28N4O6
Molecular Weight: 492.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(NC(=O)c1ccccn1)C(=O)N[C@@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)C(=O)OC
Standard InChI: InChI=1S/C26H28N4O6/c1-16(28-23(32)19-11-8-9-13-27-19)22(31)29-20(24(33)35-5)14-17-15-30(25(34)36-26(2,3)4)21-12-7-6-10-18(17)21/h6-13,15,20H,1,14H2,2-5H3,(H,28,32)(H,29,31)/t20-/m0/s1
Standard InChI Key: PWXSPADUYCYSHO-FQEVSTJZSA-N
Molfile:
RDKit 2D
36 38 0 0 1 0 0 0 0 0999 V2000
8.7667 -5.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5792 -5.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5792 -4.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3917 -4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1875 -5.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4625 -5.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8417 -2.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -2.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1250 -3.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2792 -2.9917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0000 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0000 -4.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7167 -2.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8792 -6.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0917 -4.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 -4.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -4.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -2.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -2.1500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7000 -6.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8417 -2.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4250 -3.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2292 -6.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7792 -6.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9750 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9750 -2.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2167 -5.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5125 -6.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9917 -7.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1417 -3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5542 -7.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8250 -6.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -4.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -3.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 2 0
4 1 1 0
5 1 1 0
6 11 1 0
7 5 2 0
8 6 1 0
9 10 1 0
10 8 1 0
11 12 1 0
12 13 1 6
13 3 1 0
14 12 1 0
15 2 1 0
16 2 2 0
17 9 1 0
18 17 1 0
19 6 2 0
20 9 2 0
21 14 2 0
22 15 1 0
23 8 2 0
24 14 1 0
25 5 1 0
26 7 1 0
27 18 2 0
28 17 2 0
29 22 1 0
30 22 1 0
31 22 1 0
32 24 1 0
33 25 2 0
34 33 1 0
35 36 2 0
36 28 1 0
7 3 1 0
34 26 2 0
35 27 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.53Molecular Weight (Monoisotopic): 492.2009AlogP: 2.96#Rotatable Bonds: 7Polar Surface Area: 128.62Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.56CX Basic pKa: 1.97CX LogP: 2.58CX LogD: 2.58Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.67
References 1. Ayida BK, Simonsen KB, Vourloumis D, Hermann T.. (2005) Synthesis of dehydroalanine fragments as thiostrepton side chain mimetics., 15 (10): [PMID:15863296 ] [10.1016/j.bmcl.2005.03.084 ]