apigenin-4'-O-glucoside

ID: ALA3747599

Cas Number: 28757-27-9

PubChem CID: 14730806

Max Phase: Preclinical

Molecular Formula: C21H20O10

Molecular Weight: 432.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1cc(-c2ccc(O)cc2)oc2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12

Standard InChI:  InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)30-15-6-11(24)5-14-17(15)12(25)7-13(29-14)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1

Standard InChI Key:  ZFPMFULXUJZHFG-QNDFHXLGSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    1.5685   -5.8503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9114   -7.1922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2450   -5.8342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969   -2.9922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4882   -1.7802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6056   -5.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9072   -5.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2037   -5.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1985   -3.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4941   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995   -2.9981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2928   -2.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2125    0.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8985    3.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4965    3.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5065    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1925    3.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6321    1.3486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5317    3.6272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5 11  1  0
 10  4  1  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  6
  7  1  1  1
  8  2  1  6
  9  3  1  1
  6 12  1  6
 14 13  1  0
 15 18  1  0
 16 14  1  0
 17 13  1  0
 18 17  1  0
 19 13  2  0
 20 17  2  0
 21 19  1  0
 22 15  1  0
 23 21  2  0
 24 14  2  0
 25 22  2  0
 26 22  1  0
 12 19  1  0
 27 29  1  0
 28 25  1  0
 29 26  2  0
 30 23  1  0
 31 27  1  0
 16 15  2  0
 20 23  1  0
 28 27  2  0
M  END

Alternative Forms

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.38Molecular Weight (Monoisotopic): 432.1056AlogP: 0.05#Rotatable Bonds: 4
Polar Surface Area: 170.05Molecular Species: NEUTRALHBA: 10HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.53CX Basic pKa: CX LogP: -0.21CX LogD: -1.13
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: 2.01

References

1. Krasteva I, Bratkov V, Bucar F, Kunert O, Kollroser M, Kondeva-Burdina M, Ionkova I..  (2015)  Flavoalkaloids and Flavonoids from Astragalus monspessulanus.,  78  (11): [PMID:26558405] [10.1021/acs.jnatprod.5b00502]

Source