The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
apigenin-4'-O-glucoside ID: ALA3747599
Cas Number: 28757-27-9
PubChem CID: 14730806
Max Phase: Preclinical
Molecular Formula: C21H20O10
Molecular Weight: 432.38
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1cc(-c2ccc(O)cc2)oc2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12
Standard InChI: InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)30-15-6-11(24)5-14-17(15)12(25)7-13(29-14)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1
Standard InChI Key: ZFPMFULXUJZHFG-QNDFHXLGSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
1.5685 -5.8503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9114 -7.1922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2450 -5.8342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 -2.9922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4882 -1.7802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6056 -5.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 -5.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2037 -5.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1985 -3.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4941 -2.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 -2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9086 1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2125 0.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8985 3.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4965 3.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5065 1.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5317 3.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 11 1 0
10 4 1 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 6
7 1 1 1
8 2 1 6
9 3 1 1
6 12 1 6
14 13 1 0
15 18 1 0
16 14 1 0
17 13 1 0
18 17 1 0
19 13 2 0
20 17 2 0
21 19 1 0
22 15 1 0
23 21 2 0
24 14 2 0
25 22 2 0
26 22 1 0
12 19 1 0
27 29 1 0
28 25 1 0
29 26 2 0
30 23 1 0
31 27 1 0
16 15 2 0
20 23 1 0
28 27 2 0
M END Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.38Molecular Weight (Monoisotopic): 432.1056AlogP: 0.05#Rotatable Bonds: 4Polar Surface Area: 170.05Molecular Species: NEUTRALHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.53CX Basic pKa: ┄CX LogP: -0.21CX LogD: -1.13Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: 2.01
References 1. Krasteva I, Bratkov V, Bucar F, Kunert O, Kollroser M, Kondeva-Burdina M, Ionkova I.. (2015) Flavoalkaloids and Flavonoids from Astragalus monspessulanus., 78 (11): [PMID:26558405 ] [10.1021/acs.jnatprod.5b00502 ]