The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-4-(8-bromo-(E)-2-styrylbenzo[b]furo[3,2-d][1,3]oxazin-4-ylideno)but-(E)-2-enoic acid ethyl este ID: ALA375808
PubChem CID: 11858405
Max Phase: Preclinical
Molecular Formula: C24H18BrNO4
Molecular Weight: 464.32
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/C=C/C=C1\OC(/C=C/c2ccccc2)=Nc2c1oc1ccc(Br)cc21
Standard InChI: InChI=1S/C24H18BrNO4/c1-2-28-22(27)10-6-9-20-24-23(18-15-17(25)12-13-19(18)30-24)26-21(29-20)14-11-16-7-4-3-5-8-16/h3-15H,2H2,1H3/b10-6+,14-11+,20-9-
Standard InChI Key: XCVMDZSUEMPSHQ-YGLVHGNISA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
7.1548 -3.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4940 -3.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3153 -4.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6340 -2.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4542 -2.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7962 -3.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6222 -3.2514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0689 -2.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7921 -2.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5119 -2.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5099 -1.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7820 -0.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0651 -1.1962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2274 -2.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9408 -2.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7766 0.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4883 0.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4829 1.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2010 1.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1960 2.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4783 2.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7643 2.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7728 1.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3340 -3.0934 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
12.6563 -2.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3696 -2.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0851 -2.4275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3675 -1.1919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7984 -2.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5140 -2.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 14 2 0
6 7 1 0
14 15 1 0
7 9 1 0
12 16 1 0
8 5 1 0
16 17 2 0
1 2 2 0
17 18 1 0
5 4 2 0
18 19 2 0
8 9 2 0
19 20 1 0
4 1 1 0
20 21 2 0
9 10 1 0
21 22 1 0
5 6 1 0
22 23 2 0
23 18 1 0
10 11 1 0
1 24 1 0
15 25 2 0
11 12 1 0
25 26 1 0
2 3 1 0
26 27 1 0
12 13 2 0
26 28 2 0
13 8 1 0
27 29 1 0
3 6 2 0
29 30 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.32Molecular Weight (Monoisotopic): 463.0419AlogP: 6.43#Rotatable Bonds: 5Polar Surface Area: 61.03Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.17CX LogP: 6.15CX LogD: 6.15Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: 0.02
References 1. Ando Y, Ando K, Yamaguchi M, Kunitomo J, Koida M, Fukuyama R, Nakamuta H, Yamashita M, Ohta S, Ohishi Y.. (2006) A novel oxazine ring closure reaction affording (Z)-((E)-2-styrylbenzo[b]furo[3,2-d][1,3]oxazin-4-ylideno)acetaldehydes and their anti-osteoclastic bone resorption activity., 16 (22): [PMID:16945531 ] [10.1016/j.bmcl.2006.08.064 ] 2. Tabuchi Y, Ando Y, Kanemura H, Kawasaki I, Ohishi T, Koida M, Fukuyama R, Nakamuta H, Ohta S, Nishide K, Ohishi Y.. (2009) Preparation of novel (Z)-4-ylidenebenzo[b]furo[3,2-d][1,3]oxazines and their biological activity., 17 (11): [PMID:19406645 ] [10.1016/j.bmc.2009.04.017 ]