2-amino-alpha-desmotroposantonin

ID: ALA4081525

PubChem CID: 137647870

Max Phase: Preclinical

Molecular Formula: C15H19NO3

Molecular Weight: 261.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(N)c(O)c(C)c2c1CC[C@H]1[C@H](C)C(=O)O[C@@H]21

Standard InChI:  InChI=1S/C15H19NO3/c1-6-9-4-5-10-7(2)15(18)19-14(10)11(9)8(3)13(17)12(6)16/h7,10,14,17H,4-5,16H2,1-3H3/t7-,10-,14+/m0/s1

Standard InChI Key:  WQHVGJIEKAISOG-MRCLBUSBSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   17.3363   -9.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6186   -9.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9052   -9.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9052  -10.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1938  -11.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4760  -10.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4760   -9.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1938   -9.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7584  -11.0268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6269  -11.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3363  -10.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9432  -11.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6130  -11.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7975  -11.8283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0303  -12.6253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7542  -10.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0491  -10.2029    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.0432  -11.6124    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.1954   -8.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7640   -9.3757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1954  -11.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  4  5  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  3  8  2  0
  6  9  1  0
  4 10  1  0
 11 10  1  0
 11  1  1  0
 11 12  1  0
 13 12  1  0
 14 13  1  0
 10 14  1  0
 13 15  2  0
 12 16  1  6
 11 17  1  6
 10 18  1  6
  8 19  1  0
  7 20  1  0
  5 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4081525

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 261.32Molecular Weight (Monoisotopic): 261.1365AlogP: 2.39#Rotatable Bonds:
Polar Surface Area: 72.55Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.95CX Basic pKa: 4.56CX LogP: 2.79CX LogD: 2.79
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.43Np Likeness Score: 1.73

References

1. Chinthakindi PK, Singh J, Gupta S, Nargotra A, Mahajan P, Kaul A, Ahmed Z, Koul S, Sangwan PL..  (2017)  Synthesis of α-santonin derivatives for diminutive effect on T and B-cell proliferation and their structure activity relationships.,  127  [PMID:27847171] [10.1016/j.ejmech.2016.11.018]

Source