The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(3-((2-(2-hydroxybenzoyl)hydrazono)methyl)phenoxy)-3-(phenylsulfonyl)-1,2,5-oxadiazole 2-oxide ID: ALA4095583
PubChem CID: 137654074
Max Phase: Preclinical
Molecular Formula: C22H16N4O7S
Molecular Weight: 480.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N/N=C/c1cccc(Oc2no[n+]([O-])c2S(=O)(=O)c2ccccc2)c1)c1ccccc1O
Standard InChI: InChI=1S/C22H16N4O7S/c27-19-12-5-4-11-18(19)20(28)24-23-14-15-7-6-8-16(13-15)32-21-22(26(29)33-25-21)34(30,31)17-9-2-1-3-10-17/h1-14,27H,(H,24,28)/b23-14+
Standard InChI Key: CHKIBKIZIJIQSR-OEAKJJBVSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
28.3664 -10.4130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1960 -9.4720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9884 -9.6866 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.7781 -8.8930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2518 -10.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2466 -11.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9490 -12.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6572 -11.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6585 -10.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9555 -10.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0739 -10.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1594 -11.6335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9585 -11.8045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3680 -11.0972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8219 -10.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7694 -9.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3726 -9.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1493 -9.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3201 -8.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7081 -8.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9338 -8.6412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5461 -10.4054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8364 -10.8106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1307 -10.3986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4210 -10.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7153 -10.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4171 -11.6210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7210 -9.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0161 -9.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3055 -9.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3042 -10.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0097 -10.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1808 -11.0128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4312 -9.1729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 1 1 0
1 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
15 3 1 0
3 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
5 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
14 33 1 0
28 34 1 0
M CHG 2 14 1 33 -1
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.46Molecular Weight (Monoisotopic): 480.0740AlogP: 2.40#Rotatable Bonds: 7Polar Surface Area: 158.03Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.03CX Basic pKa: ┄CX LogP: 3.22CX LogD: 3.12Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: -1.35
References 1. Dutra LA, Guanaes JFO, Johmann N, Lopes Pires ME, Chin CM, Marcondes S, Dos Santos JL.. (2017) Synthesis, antiplatelet and antithrombotic activities of resveratrol derivatives with NO-donor properties., 27 (11): [PMID:28400236 ] [10.1016/j.bmcl.2017.04.007 ]