(2R,3R,6S)-3,5-Diamino-2-[2-(3-amino-propylamino)-ethoxy]-6-(7-trifluoromethyl-quinolin-4-ylsulfanylmethoxy)-cyclohexanol

ID: ALA412096

PubChem CID: 44404592

Max Phase: Preclinical

Molecular Formula: C22H32F3N5O3S

Molecular Weight: 503.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCCNCCO[C@H]1C(O)[C@@H](OCSc2ccnc3cc(C(F)(F)F)ccc23)C(N)C[C@H]1N

Standard InChI:  InChI=1S/C22H32F3N5O3S/c23-22(24,25)13-2-3-14-17(10-13)30-7-4-18(14)34-12-33-21-16(28)11-15(27)20(19(21)31)32-9-8-29-6-1-5-26/h2-4,7,10,15-16,19-21,29,31H,1,5-6,8-9,11-12,26-28H2/t15-,16?,19?,20-,21+/m1/s1

Standard InChI Key:  IHRASRQJRXKRMB-MRVXTYKXSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  1  0  0  0  0  0999 V2000
    2.6542   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1833    2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2500    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5792   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2125   -0.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2250    1.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8042    0.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9958    0.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5333    2.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6458    1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1125    1.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1083    0.0250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5708    0.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7625    2.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8375    0.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6958    2.0333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6708    3.3333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8333    3.1958    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6125    0.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1917    0.9708    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -1.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9250   -0.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9250    0.7833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5750   -1.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4458   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6750   -0.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667   -2.6792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7042   -2.6667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4250   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 10  1  0
  3  1  1  0
  4  1  1  0
  5  4  1  0
  6  3  1  0
  7 14  1  0
  8  5  1  0
  9  7  1  0
 10 15  2  0
 11  9  2  0
 12  7  2  0
 13 26  2  0
 14 21  1  0
 15 12  1  0
 16 20  1  0
 17  2  1  0
 18  2  1  0
 19  2  1  0
  3 20  1  1
 21 16  1  0
 22  1  1  0
  5 23  1  1
 24  6  1  0
  4 25  1  6
 26 27  1  0
 27 14  2  0
 28 33  1  0
 29 32  1  0
 30 31  1  0
 31 28  1  0
 32 30  1  0
 33 34  1  0
 34 25  1  0
  8  6  1  0
 13  9  1  0
 11 10  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.59Molecular Weight (Monoisotopic): 503.2178AlogP: 1.43#Rotatable Bonds: 11
Polar Surface Area: 141.67Molecular Species: BASEHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.12CX Basic pKa: 10.12CX LogP: -0.01CX LogD: -5.73
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -0.20

References

1. Wang X, Migawa MT, Sannes-Lowery KA, Swayze EE..  (2005)  The synthesis and 16S A-site rRNA recognition of carbohydrate-free aminoglycosides.,  15  (22): [PMID:16168642] [10.1016/j.bmcl.2005.08.027]

Source