2-[(1R,3S,6R)-4,6-Diamino-2-hydroxy-3-(7-trifluoromethyl-quinolin-4-ylsulfanylmethoxy)-cyclohexyloxy]-N-(3-dimethylamino-propyl)-acetamide

ID: ALA436502

PubChem CID: 44404594

Max Phase: Preclinical

Molecular Formula: C24H34F3N5O4S

Molecular Weight: 545.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCCNC(=O)CO[C@H]1C(O)[C@@H](OCSc2ccnc3cc(C(F)(F)F)ccc23)C(N)C[C@H]1N

Standard InChI:  InChI=1S/C24H34F3N5O4S/c1-32(2)9-3-7-31-20(33)12-35-22-16(28)11-17(29)23(21(22)34)36-13-37-19-6-8-30-18-10-14(24(25,26)27)4-5-15(18)19/h4-6,8,10,16-17,21-23,34H,3,7,9,11-13,28-29H2,1-2H3,(H,31,33)/t16-,17?,21?,22-,23+/m1/s1

Standard InChI Key:  ODQYVYHOFMVCAB-KNZXZDMCSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  1  0  0  0  0  0999 V2000
    3.2792   -2.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2042   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5583    1.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750   -1.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8375   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5542   -1.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6000   -0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4292   -1.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3708   -0.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9083    0.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2000   -2.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0208   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4875    0.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4833   -1.5292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9042   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0542   -0.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1375    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4625   -1.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6167   -4.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0708    0.4708    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0458    1.7708    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2083    1.6333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2375   -0.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9042   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8167   -0.5875    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9917   -2.8667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5500   -1.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5500   -0.7750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1917   -4.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8208   -2.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500   -1.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3292   -4.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625   -4.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4792   -3.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6167   -3.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3292   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 10  1  0
  4  1  1  0
  5  2  1  0
  6  4  1  0
  7 16  1  0
  8  6  1  0
  9  7  1  0
 10 17  2  0
  2 11  1  6
 12  9  2  0
 13  7  2  0
 14 30  2  0
 15 24  1  0
 16 25  1  0
 17 13  1  0
 18 23  1  0
 19 15  2  0
 20  3  1  0
 21  3  1  0
 22  3  1  0
  4 23  1  1
 24 11  1  0
 25 18  1  0
 26  1  1  0
  5 27  1  1
 28  6  1  0
 29 15  1  0
 30 31  1  0
 31 16  2  0
 32 35  1  0
 33 34  1  0
 34 29  1  0
 35 33  1  0
 36 32  1  0
 37 32  1  0
  5  8  1  0
 14  9  1  0
 12 10  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.63Molecular Weight (Monoisotopic): 545.2284AlogP: 1.56#Rotatable Bonds: 11
Polar Surface Area: 135.96Molecular Species: BASEHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.12CX Basic pKa: 9.49CX LogP: 0.06CX LogD: -3.94
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.19Np Likeness Score: -0.68

References

1. Wang X, Migawa MT, Sannes-Lowery KA, Swayze EE..  (2005)  The synthesis and 16S A-site rRNA recognition of carbohydrate-free aminoglycosides.,  15  (22): [PMID:16168642] [10.1016/j.bmcl.2005.08.027]

Source