The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(1R,3S,6R)-4,6-Diamino-2-hydroxy-3-(7-trifluoromethyl-quinolin-4-ylsulfanylmethoxy)-cyclohexyloxy]-N-(3-dimethylamino-propyl)-acetamide ID: ALA436502
PubChem CID: 44404594
Max Phase: Preclinical
Molecular Formula: C24H34F3N5O4S
Molecular Weight: 545.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCNC(=O)CO[C@H]1C(O)[C@@H](OCSc2ccnc3cc(C(F)(F)F)ccc23)C(N)C[C@H]1N
Standard InChI: InChI=1S/C24H34F3N5O4S/c1-32(2)9-3-7-31-20(33)12-35-22-16(28)11-17(29)23(21(22)34)36-13-37-19-6-8-30-18-10-14(24(25,26)27)4-5-15(18)19/h4-6,8,10,16-17,21-23,34H,3,7,9,11-13,28-29H2,1-2H3,(H,31,33)/t16-,17?,21?,22-,23+/m1/s1
Standard InChI Key: ODQYVYHOFMVCAB-KNZXZDMCSA-N
Molfile:
RDKit 2D
37 39 0 0 1 0 0 0 0 0999 V2000
3.2792 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2042 -1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5583 1.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8375 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5542 -1.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6000 -0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3708 -0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9083 0.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2000 -2.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0208 -0.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4875 0.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4833 -1.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9042 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0542 -0.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1375 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4625 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6167 -4.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0708 0.4708 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.0458 1.7708 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.2083 1.6333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2375 -0.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9042 -3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8167 -0.5875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 -2.8667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 -1.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5500 -0.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1917 -4.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8208 -2.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0500 -1.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 -4.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7625 -4.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4792 -3.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0500 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6167 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3292 -5.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 10 1 0
4 1 1 0
5 2 1 0
6 4 1 0
7 16 1 0
8 6 1 0
9 7 1 0
10 17 2 0
2 11 1 6
12 9 2 0
13 7 2 0
14 30 2 0
15 24 1 0
16 25 1 0
17 13 1 0
18 23 1 0
19 15 2 0
20 3 1 0
21 3 1 0
22 3 1 0
4 23 1 1
24 11 1 0
25 18 1 0
26 1 1 0
5 27 1 1
28 6 1 0
29 15 1 0
30 31 1 0
31 16 2 0
32 35 1 0
33 34 1 0
34 29 1 0
35 33 1 0
36 32 1 0
37 32 1 0
5 8 1 0
14 9 1 0
12 10 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.63Molecular Weight (Monoisotopic): 545.2284AlogP: 1.56#Rotatable Bonds: 11Polar Surface Area: 135.96Molecular Species: BASEHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.12CX Basic pKa: 9.49CX LogP: 0.06CX LogD: -3.94Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.19Np Likeness Score: -0.68
References 1. Wang X, Migawa MT, Sannes-Lowery KA, Swayze EE.. (2005) The synthesis and 16S A-site rRNA recognition of carbohydrate-free aminoglycosides., 15 (22): [PMID:16168642 ] [10.1016/j.bmcl.2005.08.027 ]