2,3-didodecanamidopropanoic acid

ID: ALA4474347

PubChem CID: 155536867

Max Phase: Preclinical

Molecular Formula: C27H52N2O4

Molecular Weight: 468.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC(=O)NCC(NC(=O)CCCCCCCCCCC)C(=O)O

Standard InChI:  InChI=1S/C27H52N2O4/c1-3-5-7-9-11-13-15-17-19-21-25(30)28-23-24(27(32)33)29-26(31)22-20-18-16-14-12-10-8-6-4-2/h24H,3-23H2,1-2H3,(H,28,30)(H,29,31)(H,32,33)

Standard InChI Key:  OPUSOFDGUXUWHE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 32  0  0  0  0  0  0  0  0999 V2000
   26.7960  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5105  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2249  -14.8709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5105  -13.6334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0815  -14.4584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7960  -15.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0815  -16.1085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3671  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6526  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3671  -15.6960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9381  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2237  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5092  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7946  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0802  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3657  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6512  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9368  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0815  -16.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3671  -17.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6526  -16.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9381  -17.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2237  -16.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5092  -17.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7946  -16.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0802  -17.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3657  -16.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6512  -17.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7960  -17.3460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2223  -14.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5078  -14.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9368  -16.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2223  -17.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  6  7  1  0
  5  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  7 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 19 29  2  0
 18 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474347

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.72Molecular Weight (Monoisotopic): 468.3927AlogP: 6.51#Rotatable Bonds: 24
Polar Surface Area: 95.50Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.98CX Basic pKa: CX LogP: 7.31CX LogD: 4.14
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.14Np Likeness Score: 0.01

References

1. Stachurski O, Neubauer D, Małuch I, Wyrzykowski D, Bauer M, Bartoszewska S, Kamysz W, Sikorska E..  (2019)  Effect of self-assembly on antimicrobial activity of double-chain short cationic lipopeptides.,  27  (23): [PMID:31668583] [10.1016/j.bmc.2019.115129]

Source