The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((3-methoxyacridin-9-ylamino)methyl)-N-phenylbenzamide ID: ALA4514128
PubChem CID: 155539262
Max Phase: Preclinical
Molecular Formula: C28H23N3O2
Molecular Weight: 433.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(NCc3ccc(C(=O)Nc4ccccc4)cc3)c3ccccc3nc2c1
Standard InChI: InChI=1S/C28H23N3O2/c1-33-22-15-16-24-26(17-22)31-25-10-6-5-9-23(25)27(24)29-18-19-11-13-20(14-12-19)28(32)30-21-7-3-2-4-8-21/h2-17H,18H2,1H3,(H,29,31)(H,30,32)
Standard InChI Key: QSBRTCFLXGPXOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-2.4806 -2.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4817 -2.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7737 -3.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7755 -1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0668 -2.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0661 -2.9030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3576 -3.3101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3631 -1.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3460 -2.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3495 -2.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0619 -3.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7711 -2.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7635 -2.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0506 -1.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3675 -0.8566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3381 -0.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3337 0.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0398 0.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0358 1.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3254 2.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3825 1.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3750 0.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3200 2.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0250 3.2323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3904 3.2230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7354 2.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7374 2.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4470 1.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1529 2.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1449 2.8406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4347 3.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4818 -3.2936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4877 -4.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
12 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.51Molecular Weight (Monoisotopic): 433.1790AlogP: 6.26#Rotatable Bonds: 6Polar Surface Area: 63.25Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.19CX LogP: 5.64CX LogD: 4.19Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.00
References 1. Zhang B, Dou Z, Xiong Z, Wang N, He S, Yan X, Jin H.. (2019) Design, synthesis and biological research of novel N-phenylbenzamide-4-methylamine acridine derivatives as potential topoisomerase I/II and apoptosis-inducing agents., 29 (23): [PMID:31635931 ] [10.1016/j.bmcl.2019.126714 ]