(6-(1,4'-bipiperidin-1'-yl)-3-methylpyrrolo[2,1-a]phthalazine-1,2-diyl)bis(methylene)bis(isopropylcarbamate)

ID: ALA4514483

PubChem CID: 155539330

Max Phase: Preclinical

Molecular Formula: C32H46N6O4

Molecular Weight: 578.76

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(COC(=O)NC(C)C)c(COC(=O)NC(C)C)c2c3ccccc3c(N3CCC(N4CCCCC4)CC3)nn12

Standard InChI:  InChI=1S/C32H46N6O4/c1-21(2)33-31(39)41-19-27-23(5)38-29(28(27)20-42-32(40)34-22(3)4)25-11-7-8-12-26(25)30(35-38)37-17-13-24(14-18-37)36-15-9-6-10-16-36/h7-8,11-12,21-22,24H,6,9-10,13-20H2,1-5H3,(H,33,39)(H,34,40)

Standard InChI Key:  WYPKCWKXCLFPEX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
   13.6688  -16.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6677  -16.9432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3824  -17.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3806  -15.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0960  -16.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0948  -16.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5275  -16.1143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8100  -15.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5264  -16.9427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8079  -17.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9769  -18.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7998  -18.2539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1385  -17.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9633  -17.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4391  -18.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2095  -18.9699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0345  -18.9730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6143  -18.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8100  -14.8718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5300  -14.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5320  -13.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8194  -13.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1032  -13.6351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0996  -14.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8226  -12.3988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5384  -11.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5435  -11.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8325  -10.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1146  -11.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1078  -11.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2043  -19.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3794  -19.5108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6194  -20.2207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4443  -19.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2692  -19.6922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0290  -20.4019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6844  -18.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5094  -18.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9643  -18.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1394  -18.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3742  -18.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2747  -18.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 13 14  1  0
 11 15  1  0
 12 16  1  0
 16 17  1  0
 15 18  1  0
  8 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 18 31  1  0
 31 32  1  0
 31 33  2  0
 17 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 32 39  1  0
 39 40  1  0
 39 41  1  0
 37 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514483

    ---

Associated Targets(Human)

CCRF-CEM (65223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 578.76Molecular Weight (Monoisotopic): 578.3581AlogP: 5.52#Rotatable Bonds: 8
Polar Surface Area: 100.44Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.78CX LogP: 4.95CX LogD: 2.59
Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.36Np Likeness Score: -0.81

References

1. Chang SM, Jain V, Chen TL, Patel AS, Pidugu HB, Lin YW, Wu MH, Huang JR, Wu HC, Shah A, Su TL, Lee TC..  (2019)  Design and Synthesis of 1,2-Bis(hydroxymethyl)pyrrolo[2,1- a]phthalazine Hybrids as Potent Anticancer Agents that Inhibit Angiogenesis and Induce DNA Interstrand Cross-links.,  62  (5): [PMID:30776229] [10.1021/acs.jmedchem.8b01689]

Source