(S)-4-(4-methoxybenzoyl)-1-(4-(methylthio)benzyl)-6-phenethylpiperazin-2-one

ID: ALA4514498

PubChem CID: 122600701

Max Phase: Preclinical

Molecular Formula: C28H30N2O3S

Molecular Weight: 474.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)N2CC(=O)N(Cc3ccc(SC)cc3)[C@@H](CCc3ccccc3)C2)cc1

Standard InChI:  InChI=1S/C28H30N2O3S/c1-33-25-14-11-23(12-15-25)28(32)29-19-24(13-8-21-6-4-3-5-7-21)30(27(31)20-29)18-22-9-16-26(34-2)17-10-22/h3-7,9-12,14-17,24H,8,13,18-20H2,1-2H3/t24-/m0/s1

Standard InChI Key:  PPORCVZVLJRZAZ-DEOSSOPVSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    4.1556  -14.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8681  -14.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8694  -15.3251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5752  -14.0900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2821  -14.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9912  -14.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9941  -13.2729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2818  -12.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5665  -13.2711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7021  -14.5089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2833  -12.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7068  -12.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4178  -13.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4109  -14.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1210  -14.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1232  -12.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8339  -13.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8391  -14.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9917  -11.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9932  -10.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7048  -10.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7067   -9.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9992   -9.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2884   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2900  -10.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1581  -13.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4465  -12.8586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7328  -13.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7352  -14.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4474  -14.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0247  -12.8620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0238  -12.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5482  -14.5006    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.5511  -15.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  6 10  2  0
  8 11  1  6
  7 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 18  2  0
 17 16  2  0
 16 13  1  0
 17 18  1  0
 11 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  1 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  1  1  0
 28 31  1  0
 31 32  1  0
 18 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514498

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.63Molecular Weight (Monoisotopic): 474.1977AlogP: 4.90#Rotatable Bonds: 8
Polar Surface Area: 49.85Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.93CX LogD: 4.93
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.95

References

1. Plewe MB, Whitby LR, Naik S, Brown ER, Sokolova NV, Gantla VR, York J, Nunberg JH, Zhang L, Kalveram B, Freiberg AN, Boger DL, Henkel G, McCormack K..  (2019)  SAR studies of 4-acyl-1,6-dialkylpiperazin-2-one arenavirus cell entry inhibitors.,  29  (22): [PMID:31537423] [10.1016/j.bmcl.2019.08.024]

Source