The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(4-methoxybenzoyl)-1-(4-(methylthio)benzyl)-6-phenethylpiperazin-2-one ID: ALA4514498
PubChem CID: 122600701
Max Phase: Preclinical
Molecular Formula: C28H30N2O3S
Molecular Weight: 474.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)N2CC(=O)N(Cc3ccc(SC)cc3)[C@@H](CCc3ccccc3)C2)cc1
Standard InChI: InChI=1S/C28H30N2O3S/c1-33-25-14-11-23(12-15-25)28(32)29-19-24(13-8-21-6-4-3-5-7-21)30(27(31)20-29)18-22-9-16-26(34-2)17-10-22/h3-7,9-12,14-17,24H,8,13,18-20H2,1-2H3/t24-/m0/s1
Standard InChI Key: PPORCVZVLJRZAZ-DEOSSOPVSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.1556 -14.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8681 -14.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8694 -15.3251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5752 -14.0900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2821 -14.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9912 -14.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9941 -13.2729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2818 -12.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5665 -13.2711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7021 -14.5089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2833 -12.0419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7068 -12.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4178 -13.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4109 -14.0955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1210 -14.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1232 -12.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8339 -13.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8391 -14.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9917 -11.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9932 -10.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7048 -10.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7067 -9.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9992 -9.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2884 -9.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2900 -10.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1581 -13.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4465 -12.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7328 -13.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7352 -14.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4474 -14.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0247 -12.8620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0238 -12.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5482 -14.5006 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5511 -15.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
6 10 2 0
8 11 1 6
7 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 18 2 0
17 16 2 0
16 13 1 0
17 18 1 0
11 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
1 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 1 1 0
28 31 1 0
31 32 1 0
18 33 1 0
33 34 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.63Molecular Weight (Monoisotopic): 474.1977AlogP: 4.90#Rotatable Bonds: 8Polar Surface Area: 49.85Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.93CX LogD: 4.93Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.95
References 1. Plewe MB, Whitby LR, Naik S, Brown ER, Sokolova NV, Gantla VR, York J, Nunberg JH, Zhang L, Kalveram B, Freiberg AN, Boger DL, Henkel G, McCormack K.. (2019) SAR studies of 4-acyl-1,6-dialkylpiperazin-2-one arenavirus cell entry inhibitors., 29 (22): [PMID:31537423 ] [10.1016/j.bmcl.2019.08.024 ]