(1'S)-1',5'-Anhydro-D-glucitol-spiro-[1',5]-2-phenyl-imidazolin-4-one

ID: ALA4514550

PubChem CID: 138753252

Max Phase: Preclinical

Molecular Formula: C14H16N2O6

Molecular Weight: 308.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1N=C(c2ccccc2)N[C@@]12O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O

Standard InChI:  InChI=1S/C14H16N2O6/c17-6-8-9(18)10(19)11(20)14(22-8)13(21)15-12(16-14)7-4-2-1-3-5-7/h1-5,8-11,17-20H,6H2,(H,15,16,21)/t8-,9-,10+,11-,14+/m1/s1

Standard InChI Key:  BCSCGCOVRJYILO-QEGBUVANSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   17.2889  -20.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9951  -21.4832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5747  -22.3030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1583  -21.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5705  -19.8439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2849  -21.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5705  -21.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8645  -21.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8645  -20.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1583  -19.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1620  -19.0268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1061  -20.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3605  -19.4798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6975  -18.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0388  -19.4798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6963  -18.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5857  -20.9182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4050  -17.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4041  -16.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6953  -16.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9858  -16.9608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9902  -17.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9  5  1  0
  5  1  1  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  1
  6  2  1  6
  7  3  1  1
  8  4  1  6
 10 11  1  0
  1 12  1  6
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15  1  1  0
 14 16  1  0
 12 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514550

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.29Molecular Weight (Monoisotopic): 308.1008AlogP: -2.27#Rotatable Bonds: 2
Polar Surface Area: 131.61Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: -1.47CX LogD: -1.47
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.42Np Likeness Score: 1.08

References

1. Szabó KE, Kyriakis E, Psarra AG, Karra AG, Sipos Á, Docsa T, Stravodimos GA, Katsidou E, Skamnaki VT, Liggri PGV, Zographos SE, Mándi A, Király SB, Kurtán T, Leonidas DD, Somsák L..  (2019)  Glucopyranosylidene-spiro-imidazolinones, a New Ring System: Synthesis and Evaluation as Glycogen Phosphorylase Inhibitors by Enzyme Kinetics and X-ray Crystallography.,  62  (13): [PMID:31251604] [10.1021/acs.jmedchem.9b00356]

Source