(S)-6-phenethyl-4-(2-(piperidin-1-yl)thiazole-5-carbonyl)-1-(3-(trifluoromethyl)benzyl)piperazin-2-one

ID: ALA4514603

PubChem CID: 122600661

Max Phase: Preclinical

Molecular Formula: C29H31F3N4O2S

Molecular Weight: 556.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1cnc(N2CCCCC2)s1)N1CC(=O)N(Cc2cccc(C(F)(F)F)c2)[C@@H](CCc2ccccc2)C1

Standard InChI:  InChI=1S/C29H31F3N4O2S/c30-29(31,32)23-11-7-10-22(16-23)18-36-24(13-12-21-8-3-1-4-9-21)19-35(20-26(36)37)27(38)25-17-33-28(39-25)34-14-5-2-6-15-34/h1,3-4,7-11,16-17,24H,2,5-6,12-15,18-20H2/t24-/m0/s1

Standard InChI Key:  UECGMAXFERLRNS-DEOSSOPVSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   29.5876  -13.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3047  -13.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3026  -14.2972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0137  -13.0548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7224  -13.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4262  -13.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4306  -12.2374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7220  -11.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0048  -12.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1410  -13.4770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7242  -11.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1440  -11.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8588  -12.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8525  -13.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5619  -13.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5653  -11.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2797  -12.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2835  -13.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4270  -10.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4293   -9.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1451   -9.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1438   -8.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4342   -8.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7278   -8.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7303   -9.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9845  -11.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6951  -12.2275    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.9787  -11.0068    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.6869  -11.4077    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.4985  -12.2383    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.6881  -12.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2727  -12.7820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8264  -13.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3568  -11.3178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8419  -10.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5138   -9.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7013   -9.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2179  -10.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5470  -11.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  6 10  2  0
  8 11  1  6
  7 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 18  2  0
 17 16  2  0
 16 13  1  0
 17 18  1  0
 11 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  1 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33  1  2  0
 31 34  1  0
 34 35  1  0
 34 39  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514603

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.65Molecular Weight (Monoisotopic): 556.2120AlogP: 5.64#Rotatable Bonds: 7
Polar Surface Area: 56.75Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 1.46CX LogP: 5.77CX LogD: 5.77
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.38Np Likeness Score: -1.44

References

1. Plewe MB, Whitby LR, Naik S, Brown ER, Sokolova NV, Gantla VR, York J, Nunberg JH, Zhang L, Kalveram B, Freiberg AN, Boger DL, Henkel G, McCormack K..  (2019)  SAR studies of 4-acyl-1,6-dialkylpiperazin-2-one arenavirus cell entry inhibitors.,  29  (22): [PMID:31537423] [10.1016/j.bmcl.2019.08.024]

Source