The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4R,6S)-6-(3,4-dimethoxyphenyl)-4-(propylthio)-1-tosylpiperidine-3-carboxylic acid ID: ALA4514726
PubChem CID: 155539402
Max Phase: Preclinical
Molecular Formula: C24H31NO6S2
Molecular Weight: 493.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCS[C@@H]1C[C@@H](c2ccc(OC)c(OC)c2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O
Standard InChI: InChI=1S/C24H31NO6S2/c1-5-12-32-23-14-20(17-8-11-21(30-3)22(13-17)31-4)25(15-19(23)24(26)27)33(28,29)18-9-6-16(2)7-10-18/h6-11,13,19-20,23H,5,12,14-15H2,1-4H3,(H,26,27)/t19-,20+,23-/m1/s1
Standard InChI Key: GNWSNOYDXWUQJC-ZRCGQRJVSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
31.3738 -9.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9413 -8.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0865 -8.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6330 -7.0206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7973 -7.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0845 -8.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5745 -9.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6533 -9.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3795 -9.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0834 -6.9144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0650 -10.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6533 -7.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5170 -8.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0810 -7.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6230 -10.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2256 -7.7394 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.5124 -8.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8080 -7.0206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7943 -8.1539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3653 -8.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9413 -8.1497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8072 -9.3904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3653 -8.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0724 -9.3844 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.0712 -10.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2557 -10.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0141 -9.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3082 -11.7488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7541 -12.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7003 -11.3855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9035 -11.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7783 -10.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7771 -11.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23 20 1 0
15 9 1 0
13 17 1 0
2 8 1 0
17 5 2 0
11 15 2 0
3 1 1 0
14 19 1 0
21 12 1 0
22 13 2 0
5 6 1 0
20 12 1 0
16 4 2 0
6 3 2 0
2 9 1 1
20 14 1 1
21 2 1 0
7 27 1 0
3 22 1 0
9 7 2 0
21 16 1 0
16 18 2 0
14 10 2 0
8 23 1 0
26 11 1 0
16 17 1 0
23 24 1 6
24 25 1 0
26 27 2 0
11 28 1 0
28 29 1 0
26 30 1 0
30 31 1 0
25 32 1 0
32 33 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.65Molecular Weight (Monoisotopic): 493.1593AlogP: 4.36#Rotatable Bonds: 9Polar Surface Area: 93.14Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.56CX Basic pKa: ┄CX LogP: 4.24CX LogD: 0.89Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -0.59
References 1. (2013) Inhibitors of protein prenyltransferases,