(3S,4R,6S)-6-(3,4-dimethoxyphenyl)-4-(propylthio)-1-tosylpiperidine-3-carboxylic acid

ID: ALA4514726

PubChem CID: 155539402

Max Phase: Preclinical

Molecular Formula: C24H31NO6S2

Molecular Weight: 493.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCS[C@@H]1C[C@@H](c2ccc(OC)c(OC)c2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O

Standard InChI:  InChI=1S/C24H31NO6S2/c1-5-12-32-23-14-20(17-8-11-21(30-3)22(13-17)31-4)25(15-19(23)24(26)27)33(28,29)18-9-6-16(2)7-10-18/h6-11,13,19-20,23H,5,12,14-15H2,1-4H3,(H,26,27)/t19-,20+,23-/m1/s1

Standard InChI Key:  GNWSNOYDXWUQJC-ZRCGQRJVSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   31.3738   -9.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9413   -8.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0865   -8.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6330   -7.0206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7973   -7.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0845   -8.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5745   -9.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6533   -9.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3795   -9.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0834   -6.9144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0650  -10.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6533   -7.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5170   -8.9741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0810   -7.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6230  -10.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2256   -7.7394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.5124   -8.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8080   -7.0206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7943   -8.1539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.3653   -8.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9413   -8.1497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8072   -9.3904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3653   -8.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0724   -9.3844    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.0712  -10.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2557  -10.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0141   -9.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3082  -11.7488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7541  -12.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7003  -11.3855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9035  -11.2043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7783  -10.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7771  -11.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 23 20  1  0
 15  9  1  0
 13 17  1  0
  2  8  1  0
 17  5  2  0
 11 15  2  0
  3  1  1  0
 14 19  1  0
 21 12  1  0
 22 13  2  0
  5  6  1  0
 20 12  1  0
 16  4  2  0
  6  3  2  0
  2  9  1  1
 20 14  1  1
 21  2  1  0
  7 27  1  0
  3 22  1  0
  9  7  2  0
 21 16  1  0
 16 18  2  0
 14 10  2  0
  8 23  1  0
 26 11  1  0
 16 17  1  0
 23 24  1  6
 24 25  1  0
 26 27  2  0
 11 28  1  0
 28 29  1  0
 26 30  1  0
 30 31  1  0
 25 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514726

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.65Molecular Weight (Monoisotopic): 493.1593AlogP: 4.36#Rotatable Bonds: 9
Polar Surface Area: 93.14Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: 4.24CX LogD: 0.89
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -0.59

References

1.  (2013)  Inhibitors of protein prenyltransferases, 

Source