3-(benzo[d][1,3]dioxol-5-yl)-N-(4,5-dimethylthiazol-2-yl)acrylamide

ID: ALA4522338

PubChem CID: 844245

Max Phase: Preclinical

Molecular Formula: C15H14N2O3S

Molecular Weight: 302.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(NC(=O)/C=C/c2ccc3c(c2)OCO3)sc1C

Standard InChI:  InChI=1S/C15H14N2O3S/c1-9-10(2)21-15(16-9)17-14(18)6-4-11-3-5-12-13(7-11)20-8-19-12/h3-7H,8H2,1-2H3,(H,16,17,18)/b6-4+

Standard InChI Key:  HCRIOJSQDODALI-GQCTYLIASA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   35.7624   -8.9685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4701   -8.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1779   -8.9685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4701   -7.7427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7624   -9.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0547  -10.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3486   -9.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3536  -11.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0579  -11.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8856   -8.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6322   -8.8873    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.1790   -8.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7704   -7.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9711   -7.7423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1027   -6.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9917   -8.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6409  -11.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6383  -10.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8598   -9.9389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3812  -10.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8640  -11.2619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  2  0
  5  6  1  0
  6  7  2  0
  7 18  1  0
 17  8  1  0
  8  9  2  0
  9  6  1  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
 13 15  1  0
 12 16  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 302.36Molecular Weight (Monoisotopic): 302.0725AlogP: 3.14#Rotatable Bonds: 3
Polar Surface Area: 60.45Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.17CX Basic pKa: 0.33CX LogP: 3.31CX LogD: 3.25
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.88Np Likeness Score: -1.15

References

1. Zhao C, Huang D, Li R, Xu Y, Su S, Gu Q, Xu J..  (2019)  Identifying Novel Anti-Osteoporosis Leads with a Chemotype-Assembly Approach.,  62  (12): [PMID:31125222] [10.1021/acs.jmedchem.9b00517]

Source