The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(5-(4-chlorophenyl)-2-oxo-2,3-dihydro-1H-imidazol-1-yl)-4-cyclopropyl-1-ethylquinolin-2(1H)-one ID: ALA4525047
PubChem CID: 134537252
Max Phase: Preclinical
Molecular Formula: C23H20ClN3O2
Molecular Weight: 405.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)cc(C2CC2)c2cc(-n3c(-c4ccc(Cl)cc4)c[nH]c3=O)ccc21
Standard InChI: InChI=1S/C23H20ClN3O2/c1-2-26-20-10-9-17(11-19(20)18(12-22(26)28)14-3-4-14)27-21(13-25-23(27)29)15-5-7-16(24)8-6-15/h5-14H,2-4H2,1H3,(H,25,29)
Standard InChI Key: UOMQGVGGFQBCFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
20.1537 -9.0502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1642 -9.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1642 -10.8187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1537 -11.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1010 -10.8187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0905 -11.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0378 -10.8187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0378 -9.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0905 -9.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1010 -9.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9852 -11.4082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9325 -10.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1325 -11.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7220 -12.8398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9009 -12.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7852 -13.3872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6799 -9.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5430 -9.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2903 -8.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1746 -7.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3114 -7.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5641 -8.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9219 -6.2712 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.1537 -12.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7432 -13.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5642 -13.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2169 -9.0502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1537 -7.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1642 -7.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
7 11 1 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 1 0
15 11 1 0
15 16 2 0
12 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
20 23 1 0
4 24 1 0
24 25 1 0
25 26 1 0
24 26 1 0
2 27 2 0
1 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.89Molecular Weight (Monoisotopic): 405.1244AlogP: 4.70#Rotatable Bonds: 4Polar Surface Area: 59.79Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.17CX Basic pKa: ┄CX LogP: 3.83CX LogD: 3.83Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -1.02
References 1. (2018) Nitrogen-containing heterocyclic compound,