Clavukoellian A

ID: ALA4526412

PubChem CID: 155544040

Max Phase: Preclinical

Molecular Formula: C15H17NO4

Molecular Weight: 275.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C([C@@]2(C)C3=CC(=O)O[C@@H]3CC[C@@H]2C)C(=O)NC1=O

Standard InChI:  InChI=1S/C15H17NO4/c1-7-4-5-10-9(6-11(17)20-10)15(7,3)12-8(2)13(18)16-14(12)19/h6-7,10H,4-5H2,1-3H3,(H,16,18,19)/t7-,10+,15+/m0/s1

Standard InChI Key:  RDKOOACCKNABRC-VYSGVJLMSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    3.8561   -3.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8561   -4.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2711   -3.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5615   -3.5391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2711   -4.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5643   -5.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7370   -5.9803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5465   -6.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8796   -5.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9772   -3.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7272   -3.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2777   -3.2755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8681   -2.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0649   -2.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2642   -3.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5615   -2.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9579   -6.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4567   -2.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2057   -1.8145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8944   -4.6828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8552   -5.5925    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  6  1  0
  5  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  2  0
  3 10  1  0
  3 15  1  6
  4 16  1  6
  8 17  2  0
 14 18  1  0
 13 19  2  0
 11 20  2  0
  6 21  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4526412

    ---

Associated Targets(Human)

HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 275.30Molecular Weight (Monoisotopic): 275.1158AlogP: 1.25#Rotatable Bonds: 1
Polar Surface Area: 72.47Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.00CX Basic pKa: CX LogP: 1.38CX LogD: 1.38
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.58Np Likeness Score: 1.80

References

1. Wang Q, Hu Z, Luo X, Liu J, Li G, Cao S, Liu Q..  (2019)  Clavukoellians A-F, Highly Rearranged Nardosinane Sesquiterpenoids with Antiangiogenic Activity from Clavularia koellikeri.,  82  (5): [PMID:30994348] [10.1021/acs.jnatprod.9b00100]

Source