Ethyl 2-(2-(4-(2-Chlorophenyl)-1H-1,2,3-triazol-1-yl)-acetamido)-4-methylthiazole-5-carboxylate

ID: ALA4529590

PubChem CID: 155545539

Max Phase: Preclinical

Molecular Formula: C17H16ClN5O3S

Molecular Weight: 405.87

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1sc(NC(=O)Cn2cc(-c3ccccc3Cl)nn2)nc1C

Standard InChI:  InChI=1S/C17H16ClN5O3S/c1-3-26-16(25)15-10(2)19-17(27-15)20-14(24)9-23-8-13(21-22-23)11-6-4-5-7-12(11)18/h4-8H,3,9H2,1-2H3,(H,19,20,24)

Standard InChI Key:  JGTLFOSKVYVLFK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   37.6445   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3522   -4.1355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9367   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2290   -4.5441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9367   -3.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.0967   -4.4670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6435   -3.8597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2349   -3.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4356   -3.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5681   -2.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3820   -2.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7143   -1.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2338   -0.9141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4172   -1.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0886   -1.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5213   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4317   -3.3259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7706   -4.4709    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.2252   -3.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6350   -3.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2761   -1.8363    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.3024   -2.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4124   -3.9504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9325   -3.2890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0796   -4.6967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1198   -3.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6398   -2.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  3  5  2  0
  2  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  2  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  4 16  1  0
 16 17  2  0
 17 20  1  0
 19 18  1  0
 18 16  1  0
 19 20  2  0
 15 21  1  0
 20 22  1  0
 19 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4529590

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.87Molecular Weight (Monoisotopic): 405.0662AlogP: 3.18#Rotatable Bonds: 6
Polar Surface Area: 99.00Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.61CX Basic pKa: CX LogP: 3.54CX LogD: 3.34
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.63Np Likeness Score: -2.57

References

1. Zhao C, Huang D, Li R, Xu Y, Su S, Gu Q, Xu J..  (2019)  Identifying Novel Anti-Osteoporosis Leads with a Chemotype-Assembly Approach.,  62  (12): [PMID:31125222] [10.1021/acs.jmedchem.9b00517]

Source