The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-fluorophenyl)-1-methyl-3-((methyl(3,4,5-trimethoxybenzyl)amino)methyl)-1H-indole-5-carboxamide ID: ALA4531197
PubChem CID: 155546151
Max Phase: Preclinical
Molecular Formula: C28H30FN3O4
Molecular Weight: 491.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CN(C)Cc2cn(C)c3ccc(C(=O)Nc4ccc(F)cc4)cc23)cc(OC)c1OC
Standard InChI: InChI=1S/C28H30FN3O4/c1-31(15-18-12-25(34-3)27(36-5)26(13-18)35-4)16-20-17-32(2)24-11-6-19(14-23(20)24)28(33)30-22-9-7-21(29)8-10-22/h6-14,17H,15-16H2,1-5H3,(H,30,33)
Standard InChI Key: RCHCNLZGZXBVPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
26.1326 -3.0166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8449 -3.4327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5615 -3.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2709 -3.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9869 -3.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9915 -2.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2741 -1.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5610 -2.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1368 -2.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3244 -3.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8646 -4.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8635 -5.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5782 -5.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5764 -3.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2917 -4.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2966 -5.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0841 -5.3151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5660 -4.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0763 -3.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1500 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4357 -4.2418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7212 -3.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7246 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0110 -2.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2956 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2984 -3.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0127 -4.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5805 -2.5931 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.1498 -3.0043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2753 -0.9661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7075 -1.7973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6991 -3.4494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6944 -4.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4204 -2.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9905 -0.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3437 -6.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
1 9 1 0
11 12 2 0
12 13 1 0
13 16 2 0
15 14 2 0
14 11 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
11 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
19 10 1 0
10 1 1 0
20 29 2 0
7 30 1 0
6 31 1 0
5 32 1 0
32 33 1 0
31 34 1 0
30 35 1 0
17 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.56Molecular Weight (Monoisotopic): 491.2220AlogP: 5.23#Rotatable Bonds: 9Polar Surface Area: 64.96Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.94CX LogP: 4.72CX LogD: 4.07Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.26
References 1. Ostacolo C, Di Sarno V, Lauro G, Pepe G, Musella S, Ciaglia T, Vestuto V, Autore G, Bifulco G, Marzocco S, Campiglia P, Gomez-Monterrey IM, Bertamino A.. (2019) Identification of an indol-based multi-target kinase inhibitor through phenotype screening and target fishing using inverse virtual screening approach., 167 [PMID:30763817 ] [10.1016/j.ejmech.2019.01.066 ]