The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3-((([1,1'-biphenyl]-4-ylmethyl)(methyl)amino)methyl)-1-methyl-1H-indol-5-yl)methyl)-4-fluoroaniline ID: ALA4531438
PubChem CID: 155546495
Max Phase: Preclinical
Molecular Formula: C31H30FN3
Molecular Weight: 463.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1ccc(-c2ccccc2)cc1)Cc1cn(C)c2ccc(CNc3ccc(F)cc3)cc12
Standard InChI: InChI=1S/C31H30FN3/c1-34(20-23-8-11-26(12-9-23)25-6-4-3-5-7-25)21-27-22-35(2)31-17-10-24(18-30(27)31)19-33-29-15-13-28(32)14-16-29/h3-18,22,33H,19-21H2,1-2H3
Standard InChI Key: VASCWQJINXHVFZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
25.1951 -10.2205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1993 -9.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3869 -10.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9271 -11.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9259 -12.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6407 -12.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6389 -11.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3542 -11.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3591 -12.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1465 -12.5190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6285 -11.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1387 -11.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2125 -11.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4982 -11.4458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7837 -11.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7871 -10.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0734 -9.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3580 -10.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3609 -11.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0752 -11.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6430 -9.7970 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.8361 -10.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6063 -10.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2447 -10.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0144 -10.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1442 -9.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4983 -9.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7312 -9.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9093 -9.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5509 -10.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3202 -9.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4490 -8.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8024 -8.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0356 -8.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4061 -13.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
4 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
12 3 1 0
3 1 1 0
1 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
26 29 1 0
10 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.60Molecular Weight (Monoisotopic): 463.2424AlogP: 7.23#Rotatable Bonds: 8Polar Surface Area: 20.20Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.55CX LogP: 6.95CX LogD: 5.77Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.31
References 1. Ostacolo C, Di Sarno V, Lauro G, Pepe G, Musella S, Ciaglia T, Vestuto V, Autore G, Bifulco G, Marzocco S, Campiglia P, Gomez-Monterrey IM, Bertamino A.. (2019) Identification of an indol-based multi-target kinase inhibitor through phenotype screening and target fishing using inverse virtual screening approach., 167 [PMID:30763817 ] [10.1016/j.ejmech.2019.01.066 ]