The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-methyl 2-((2S,6S)-2-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(o-tolylsulfonyl)-1,2,5,6-tetrahydropyridine-3-carboxamido)-4-methylpentanoate ID: ALA4537985
PubChem CID: 58360977
Max Phase: Preclinical
Molecular Formula: C32H34Cl2N2O5S
Molecular Weight: 629.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](CC(C)C)NC(=O)C1=CC[C@@H](c2ccc(Cl)cc2)N(S(=O)(=O)c2ccccc2C)[C@H]1c1cccc(Cl)c1
Standard InChI: InChI=1S/C32H34Cl2N2O5S/c1-20(2)18-27(32(38)41-4)35-31(37)26-16-17-28(22-12-14-24(33)15-13-22)36(30(26)23-9-7-10-25(34)19-23)42(39,40)29-11-6-5-8-21(29)3/h5-16,19-20,27-28,30H,17-18H2,1-4H3,(H,35,37)/t27-,28-,30-/m0/s1
Standard InChI Key: GKUVJBCNVVJNBC-XEVVZDEMSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
5.5883 -6.9874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8029 -7.7798 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.3818 -7.1977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5128 -8.1884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5128 -9.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2180 -9.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9233 -9.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9233 -8.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2180 -7.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2180 -6.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8057 -9.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9278 -6.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9282 -5.7349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2199 -5.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5099 -5.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5130 -6.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0980 -9.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -9.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3921 -10.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1054 -10.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8091 -10.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0105 -7.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4345 -7.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6417 -7.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4248 -8.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0069 -8.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7975 -8.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6361 -5.3267 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6322 -7.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3387 -8.1926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6514 -6.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6856 -10.6440 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6346 -6.9647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0476 -7.7860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7541 -8.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0500 -6.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7589 -6.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7613 -5.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4654 -6.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7518 -9.0139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4630 -7.7902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1696 -8.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 1
5 11 1 1
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 10 1 0
11 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 11 1 0
4 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
13 28 1 0
8 29 1 0
29 30 1 0
23 31 1 0
19 32 1 0
29 33 2 0
30 34 1 0
34 35 1 0
34 36 1 1
36 37 1 0
37 38 1 0
37 39 1 0
35 40 2 0
35 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.61Molecular Weight (Monoisotopic): 628.1565AlogP: 6.81#Rotatable Bonds: 9Polar Surface Area: 92.78Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.17CX Basic pKa: ┄CX LogP: 7.26CX LogD: 7.26Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.26Np Likeness Score: -0.59
References 1. (2013) Inhibitors of protein prenyltransferases,