N-((3-(((2-([1,1'-biphenyl]-4-yl)ethyl)amino)methyl)-1-methyl-1H-indol-5-yl)methyl)-4-fluoroaniline

ID: ALA4538058

PubChem CID: 155549199

Max Phase: Preclinical

Molecular Formula: C31H30FN3

Molecular Weight: 463.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(CNCCc2ccc(-c3ccccc3)cc2)c2cc(CNc3ccc(F)cc3)ccc21

Standard InChI:  InChI=1S/C31H30FN3/c1-35-22-27(21-33-18-17-23-7-10-26(11-8-23)25-5-3-2-4-6-25)30-19-24(9-16-31(30)35)20-34-29-14-12-28(32)13-15-29/h2-16,19,22,33-34H,17-18,20-21H2,1H3

Standard InChI Key:  GCJFBTXOMFEWRL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   22.0180   -2.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0167   -3.6437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7316   -4.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7297   -2.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4451   -2.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4499   -3.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2373   -3.8900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7192   -3.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2295   -2.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3034   -2.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5891   -2.8168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8746   -2.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8780   -1.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1643   -1.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4490   -1.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4519   -2.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1661   -2.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7340   -1.1681    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.4799   -1.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2858   -1.5907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8413   -2.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6473   -2.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2028   -2.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9493   -3.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5041   -4.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3110   -3.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5600   -3.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0036   -2.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8647   -4.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6137   -5.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1694   -5.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9761   -5.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2241   -4.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6667   -4.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4969   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
  9 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 26 29  1  0
  7 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538058

    ---

Associated Targets(Human)

Jurkat (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.60Molecular Weight (Monoisotopic): 463.2424AlogP: 6.93#Rotatable Bonds: 9
Polar Surface Area: 28.99Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.71CX LogP: 6.85CX LogD: 4.59
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -1.03

References

1. Ostacolo C, Di Sarno V, Lauro G, Pepe G, Musella S, Ciaglia T, Vestuto V, Autore G, Bifulco G, Marzocco S, Campiglia P, Gomez-Monterrey IM, Bertamino A..  (2019)  Identification of an indol-based multi-target kinase inhibitor through phenotype screening and target fishing using inverse virtual screening approach.,  167  [PMID:30763817] [10.1016/j.ejmech.2019.01.066]

Source