2,4-didodecanamidobutanoic acid

ID: ALA4550912

PubChem CID: 155555323

Max Phase: Preclinical

Molecular Formula: C28H54N2O4

Molecular Weight: 482.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC(=O)NCCC(NC(=O)CCCCCCCCCCC)C(=O)O

Standard InChI:  InChI=1S/C28H54N2O4/c1-3-5-7-9-11-13-15-17-19-21-26(31)29-24-23-25(28(33)34)30-27(32)22-20-18-16-14-12-10-8-6-4-2/h25H,3-24H2,1-2H3,(H,29,31)(H,30,32)(H,33,34)

Standard InChI Key:  UQURCGHBYXUQCS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 33  0  0  0  0  0  0  0  0999 V2000
   42.5586  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2731  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9875  -14.8376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.2731  -13.6001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8441  -14.4251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5586  -15.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1297  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4152  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1297  -15.6626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.7007  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9863  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2718  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5573  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8427  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1283  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4138  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6993  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9849  -14.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2704  -14.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8441  -16.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8441  -16.9001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1297  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1297  -18.1376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4152  -16.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7007  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9863  -16.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2718  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5573  -16.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8427  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1283  -16.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4138  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6993  -16.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9849  -17.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2704  -16.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  6 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4550912

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.75Molecular Weight (Monoisotopic): 482.4084AlogP: 6.90#Rotatable Bonds: 25
Polar Surface Area: 95.50Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.99CX Basic pKa: CX LogP: 7.37CX LogD: 4.21
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.12Np Likeness Score: 0.01

References

1. Stachurski O, Neubauer D, Małuch I, Wyrzykowski D, Bauer M, Bartoszewska S, Kamysz W, Sikorska E..  (2019)  Effect of self-assembly on antimicrobial activity of double-chain short cationic lipopeptides.,  27  (23): [PMID:31668583] [10.1016/j.bmc.2019.115129]

Source