1-(3,5-dimethylpiperidin-1-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one

ID: ALA4552392

PubChem CID: 42908645

Max Phase: Preclinical

Molecular Formula: C19H27NO4

Molecular Weight: 333.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)N2CC(C)CC(C)C2)cc(OC)c1OC

Standard InChI:  InChI=1S/C19H27NO4/c1-13-8-14(2)12-20(11-13)18(21)7-6-15-9-16(22-3)19(24-5)17(10-15)23-4/h6-7,9-10,13-14H,8,11-12H2,1-5H3/b7-6+

Standard InChI Key:  QLXNOSVCACYBJX-VOTSOKGWSA-N

Molfile:  

 
     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   19.0566  -17.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0555  -18.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7702  -18.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4867  -18.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4839  -17.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7684  -17.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1967  -17.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9128  -17.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6256  -17.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3417  -17.6687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6225  -16.4338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3424  -18.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0543  -18.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7697  -18.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7686  -17.6642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0521  -17.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3421  -17.2707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3418  -16.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3407  -18.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6266  -18.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7700  -19.7482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0555  -20.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4828  -17.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0543  -19.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 10 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  1 17  1  0
 17 18  1  0
  2 19  1  0
 19 20  1  0
  3 21  1  0
 21 22  1  0
 15 23  1  0
 13 24  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 333.43Molecular Weight (Monoisotopic): 333.1940AlogP: 3.23#Rotatable Bonds: 5
Polar Surface Area: 48.00Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.88CX LogD: 2.88
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: -0.06

References

1. Zhao Z, Song H, Xie J, Liu T, Zhao X, Chen X, He X, Wu S, Zhang Y, Zheng X..  (2019)  Research progress in the biological activities of 3,4,5-trimethoxycinnamic acid (TMCA) derivatives.,  173  [PMID:31009908] [10.1016/j.ejmech.2019.04.009]

Source