The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(tert-Butyl)-3-(2-morpholinoethyl)-8-(4-morpholinophenyl)-3H-imidazo[2,1-i]purin-7-amine ID: ALA4554343
PubChem CID: 155556330
Max Phase: Preclinical
Molecular Formula: C27H36N8O2
Molecular Weight: 504.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)Nc1c(-c2ccc(N3CCOCC3)cc2)nc2c3ncn(CCN4CCOCC4)c3ncn12
Standard InChI: InChI=1S/C27H36N8O2/c1-27(2,3)31-26-22(20-4-6-21(7-5-20)33-12-16-37-17-13-33)30-25-23-24(29-19-35(25)26)34(18-28-23)9-8-32-10-14-36-15-11-32/h4-7,18-19,31H,8-17H2,1-3H3
Standard InChI Key: YIHORBJVNZJJJG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
5.9969 -22.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7063 -22.8855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9946 -21.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7063 -21.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5320 -20.4394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7151 -20.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3830 -21.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4115 -21.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4160 -22.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1954 -22.7247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6742 -22.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1881 -21.4041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5839 -21.2759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3323 -22.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5332 -22.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8798 -22.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1148 -22.8401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3053 -19.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7163 -18.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3073 -18.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4892 -18.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0819 -18.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4934 -19.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4523 -23.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9089 -24.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1658 -24.8866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6212 -25.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8751 -26.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6748 -26.4345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2203 -25.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9660 -25.0454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0747 -17.5287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4833 -16.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0761 -16.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2585 -16.1138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8499 -16.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2588 -17.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 1 1 0
1 2 2 0
2 9 1 0
8 4 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 3 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
6 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
21 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.64Molecular Weight (Monoisotopic): 504.2961AlogP: 3.13#Rotatable Bonds: 6Polar Surface Area: 84.98Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.09CX LogP: 1.78CX LogD: 1.60Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -1.49
References 1. Pelliccia S, Amato J, Capasso D, Di Gaetano S, Massarotti A, Piccolo M, Irace C, Tron GC, Pagano B, Randazzo A, Novellino E, Giustiniano M.. (2020) Bio-Inspired Dual-Selective BCL-2 /c-MYC G-Quadruplex Binders: Design, Synthesis, and Anticancer Activity of Drug-like Imidazo[2,1-i ]purine Derivatives., 63 (5): [PMID:31241946 ] [10.1021/acs.jmedchem.9b00262 ]