2-(4-(4-Nitrophenyl)-1H-1,2,3-triazol-1-yl)-N-(thiazol-2-yl)-acetamide

ID: ALA4556253

PubChem CID: 155556728

Max Phase: Preclinical

Molecular Formula: C13H10N6O3S

Molecular Weight: 330.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cn1cc(-c2ccc([N+](=O)[O-])cc2)nn1)Nc1nccs1

Standard InChI:  InChI=1S/C13H10N6O3S/c20-12(15-13-14-5-6-23-13)8-18-7-11(16-17-18)9-1-3-10(4-2-9)19(21)22/h1-7H,8H2,(H,14,15,20)

Standard InChI Key:  DLCJYRNEOVILKQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   17.9741  -19.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6818  -18.6551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2664  -18.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5587  -19.0637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2664  -17.8379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4263  -18.9866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9731  -18.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5645  -17.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7652  -17.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8977  -16.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7116  -16.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0440  -16.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5634  -15.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7468  -15.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4182  -16.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8510  -18.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7608  -17.8410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9615  -17.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5529  -18.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0998  -18.9860    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.8947  -14.6830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4135  -14.0225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7073  -14.5964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  3  5  2  0
  2  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  2  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  4 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 21 22  2  0
 21 23  1  0
 13 21  1  0
M  CHG  2  21   1  23  -1
M  END

Alternative Forms

  1. Parent:

    ALA4556253

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.33Molecular Weight (Monoisotopic): 330.0535AlogP: 1.95#Rotatable Bonds: 5
Polar Surface Area: 115.84Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.76CX Basic pKa: 0.21CX LogP: 2.25CX LogD: 2.10
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.56Np Likeness Score: -2.80

References

1. Zhao C, Huang D, Li R, Xu Y, Su S, Gu Q, Xu J..  (2019)  Identifying Novel Anti-Osteoporosis Leads with a Chemotype-Assembly Approach.,  62  (12): [PMID:31125222] [10.1021/acs.jmedchem.9b00517]

Source