The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-cyclohexyl-4-(3-methoxyphenyl)-1-(4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carboxamide ID: ALA4567531
PubChem CID: 155558663
Max Phase: Preclinical
Molecular Formula: C24H24F3N3O2
Molecular Weight: 443.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2cn(-c3ccc(C(F)(F)F)cc3)nc2C(=O)NC2CCCCC2)c1
Standard InChI: InChI=1S/C24H24F3N3O2/c1-32-20-9-5-6-16(14-20)21-15-30(19-12-10-17(11-13-19)24(25,26)27)29-22(21)23(31)28-18-7-3-2-4-8-18/h5-6,9-15,18H,2-4,7-8H2,1H3,(H,28,31)
Standard InChI Key: GFQFXZAZCAIOAW-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
24.7056 -4.4038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5227 -4.4038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7771 -3.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1142 -3.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4554 -3.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1129 -2.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8217 -1.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8208 -1.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1119 -0.6941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4025 -1.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4069 -1.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6781 -3.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5078 -2.5756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0711 -3.9220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7367 -2.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5280 -0.6931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2362 -1.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0009 -5.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6660 -5.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1448 -6.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9585 -6.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2911 -5.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8102 -4.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4419 -7.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8790 -7.6515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2236 -7.8756 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.2946 -7.0972 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5732 -1.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8060 -1.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2008 -1.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3681 -2.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1406 -2.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
4 6 1 0
5 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
8 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
2 18 1 0
24 25 1 0
24 26 1 0
24 27 1 0
21 24 1 0
15 28 1 0
15 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.47Molecular Weight (Monoisotopic): 443.1821AlogP: 5.63#Rotatable Bonds: 5Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.69CX LogD: 5.69Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.43
References 1. Zhao C, Huang D, Li R, Xu Y, Su S, Gu Q, Xu J.. (2019) Identifying Novel Anti-Osteoporosis Leads with a Chemotype-Assembly Approach., 62 (12): [PMID:31125222 ] [10.1021/acs.jmedchem.9b00517 ]