The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,5S)-N-((S)-1-amino-4-methyl-1-oxopentan-2-yl)-5-tert-butyl-2-(4-chlorophenyl)-1-(o-tolylsulfonyl)-2,5-dihydro-1H-pyrrole-3-carboxamide ID: ALA4568073
PubChem CID: 155560439
Max Phase: Preclinical
Molecular Formula: C28H36ClN3O4S
Molecular Weight: 546.13
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1S(=O)(=O)N1[C@@H](c2ccc(Cl)cc2)C(C(=O)N[C@@H](CC(C)C)C(N)=O)=C[C@H]1C(C)(C)C
Standard InChI: InChI=1S/C28H36ClN3O4S/c1-17(2)15-22(26(30)33)31-27(34)21-16-24(28(4,5)6)32(25(21)19-11-13-20(29)14-12-19)37(35,36)23-10-8-7-9-18(23)3/h7-14,16-17,22,24-25H,15H2,1-6H3,(H2,30,33)(H,31,34)/t22-,24-,25-/m0/s1
Standard InChI Key: MFIOFMJPLVDERP-HVCNVCAESA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
7.6035 -8.1163 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.9950 -8.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0452 -7.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1510 -9.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0430 -5.4293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7544 -5.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6024 -7.2935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7553 -6.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3843 -8.3738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3308 -5.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8910 -7.7079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0440 -7.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3353 -6.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4912 -8.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7104 -8.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4577 -9.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4856 -10.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6368 -9.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0407 -4.6162 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.3425 -9.7300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7386 -10.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2117 -8.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5993 -8.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7736 -9.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5616 -10.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1664 -9.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0404 -7.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0977 -8.6677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6622 -7.3250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4357 -7.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6067 -6.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3801 -6.0314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0043 -5.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0380 -7.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8156 -7.3699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9771 -6.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4248 -7.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 17 1 0
8 6 1 0
6 5 2 0
3 12 1 1
15 14 1 0
5 10 1 0
13 12 1 0
7 1 2 0
1 2 1 0
9 18 1 0
1 11 2 0
16 15 2 0
3 9 1 0
12 8 2 0
18 16 1 0
10 13 2 0
15 3 1 0
9 1 1 0
18 4 1 1
5 19 1 0
4 20 1 0
4 21 1 0
2 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 2 1 0
22 27 1 0
14 28 2 0
14 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
30 34 1 6
34 35 1 0
36 35 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.13Molecular Weight (Monoisotopic): 545.2115AlogP: 4.75#Rotatable Bonds: 8Polar Surface Area: 109.57Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.70CX Basic pKa: ┄CX LogP: 5.31CX LogD: 5.31Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.50Np Likeness Score: -0.69
References 1. (2013) Inhibitors of protein prenyltransferases,