2-(4-(3-Aminophenyl)-1H-1,2,3-triazol-1-yl)-N-(thiazol-2-yl)-acetamide

ID: ALA4571208

PubChem CID: 155562931

Max Phase: Preclinical

Molecular Formula: C13H12N6OS

Molecular Weight: 300.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1cccc(-c2cn(CC(=O)Nc3nccs3)nn2)c1

Standard InChI:  InChI=1S/C13H12N6OS/c14-10-3-1-2-9(6-10)11-7-19(18-17-11)8-12(20)16-13-15-4-5-21-13/h1-7H,8,14H2,(H,15,16,20)

Standard InChI Key:  CFALCGRHFOHYBM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    6.7769  -19.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4846  -18.7459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0692  -18.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3615  -19.1545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0692  -17.9287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2291  -19.0774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7760  -18.4701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3673  -17.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5681  -17.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7005  -17.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5145  -16.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8468  -16.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3663  -15.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5496  -15.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2210  -16.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6538  -18.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5637  -17.9318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7643  -17.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3557  -18.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9026  -19.0768    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.6596  -16.1014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  3  5  2  0
  2  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  2  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  4 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 12 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4571208

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 300.35Molecular Weight (Monoisotopic): 300.0793AlogP: 1.62#Rotatable Bonds: 4
Polar Surface Area: 98.72Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.76CX Basic pKa: 3.46CX LogP: 1.48CX LogD: 1.33
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.71Np Likeness Score: -2.67

References

1. Zhao C, Huang D, Li R, Xu Y, Su S, Gu Q, Xu J..  (2019)  Identifying Novel Anti-Osteoporosis Leads with a Chemotype-Assembly Approach.,  62  (12): [PMID:31125222] [10.1021/acs.jmedchem.9b00517]

Source