The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(1-(4-(Hept-1-yn-1-yl)phenyl)-5-methyl-1H-pyrazol-4-yl)ethylidene)hydrazinecarboximidamide ID: ALA4579163
PubChem CID: 155565434
Max Phase: Preclinical
Molecular Formula: C20H26N6
Molecular Weight: 350.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC#Cc1ccc(-n2ncc(/C(C)=N/NC(=N)N)c2C)cc1
Standard InChI: InChI=1S/C20H26N6/c1-4-5-6-7-8-9-17-10-12-18(13-11-17)26-16(3)19(14-23-26)15(2)24-25-20(21)22/h10-14H,4-7H2,1-3H3,(H4,21,22,25)/b24-15+
Standard InChI Key: TUGHDGBCYPULMT-BUVRLJJBSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
34.4579 -3.3756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2358 -3.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7158 -2.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2323 -2.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4576 -2.5596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7976 -3.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0514 -3.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3915 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4779 -4.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2300 -5.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8867 -4.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8183 -5.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1621 -5.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4897 -4.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5031 -6.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5330 -2.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9427 -3.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9405 -2.2547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7577 -2.2534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1652 -1.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9823 -1.5437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7555 -0.8380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7551 -5.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0961 -6.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3481 -6.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6891 -6.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
1 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 1 0
12 13 3 0
2 14 1 0
13 15 1 0
3 16 1 0
16 17 1 0
16 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
15 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 350.47Molecular Weight (Monoisotopic): 350.2219AlogP: 3.32#Rotatable Bonds: 6Polar Surface Area: 92.08Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.53CX LogP: 3.86CX LogD: 3.49Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.25Np Likeness Score: -1.26
References 1. Hammad A, Abutaleb NS, Elsebaei MM, Norvil AB, Alswah M, Ali AO, Abdel-Aleem JA, Alattar A, Bayoumi SA, Gowher H, Seleem MN, Mayhoub AS.. (2019) From Phenylthiazoles to Phenylpyrazoles: Broadening the Antibacterial Spectrum toward Carbapenem-Resistant Bacteria., 62 (17): [PMID:31369262 ] [10.1021/acs.jmedchem.9b00720 ]