Flustraminol F

ID: ALA4741961

PubChem CID: 162647293

Max Phase: Preclinical

Molecular Formula: C21H31BrN2O3

Molecular Weight: 439.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(C)(C)[C@@]12CCN(C)[C@@H]1N(C(O)C(O)C(C)(C)O)c1cc(Br)ccc12

Standard InChI:  InChI=1S/C21H31BrN2O3/c1-7-19(2,3)21-10-11-23(6)18(21)24(17(26)16(25)20(4,5)27)15-12-13(22)8-9-14(15)21/h7-9,12,16-18,25-27H,1,10-11H2,2-6H3/t16?,17?,18-,21-/m1/s1

Standard InChI Key:  PLFYNXPPDAGGER-YMPMHWPESA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   28.2288  -14.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2277  -15.2153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9357  -15.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9339  -13.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6426  -14.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6474  -15.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4274  -15.4592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4196  -14.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9065  -14.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6827  -14.5330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6756  -13.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8950  -13.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5197  -15.6233    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   32.3480  -15.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4825  -15.3698    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.0050  -13.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4113  -12.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1878  -13.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5922  -12.7119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9987  -12.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6841  -16.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1406  -16.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3974  -17.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3404  -16.6797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8539  -18.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1977  -17.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6075  -18.4074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4844  -16.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  2 13  1  0
 10 14  1  0
  9 15  1  1
  8 16  1  1
 16 17  1  0
 16 18  1  0
 16 19  1  0
 19 20  2  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  1  0
 23 26  1  0
 23 27  1  0
 21 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4741961

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.39Molecular Weight (Monoisotopic): 438.1518AlogP: 2.83#Rotatable Bonds: 5
Polar Surface Area: 67.17Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.21CX Basic pKa: 5.73CX LogP: 3.69CX LogD: 3.68
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.62Np Likeness Score: 1.55

References

1. Di X,Wang S,Oskarsson JT,Rouger C,Tasdemir D,Hardardottir I,Freysdottir J,Wang X,Molinski TF,Omarsdottir S.  (2020)  Bromotryptamine and Imidazole Alkaloids with Anti-inflammatory Activity from the Bryozoan Flustra foliacea.,  83  (10): [PMID:33016699] [10.1021/acs.jnatprod.0c00126]

Source