The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[2-[2-[[(6S,7R)-4,10-dihydroxy-7-methyl-5-oxo-6-propyl-7,8-dihydro-6H-anthracen-2-yl]oxy]ethoxy]ethoxy]ethanehydroxamic acid ID: ALA4743487
PubChem CID: 162645978
Max Phase: Preclinical
Molecular Formula: C24H31NO8
Molecular Weight: 461.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@@H]1C(=O)c2c(cc3cc(OCCOCCOCC(=O)NO)cc(O)c3c2O)C[C@H]1C
Standard InChI: InChI=1S/C24H31NO8/c1-3-4-18-14(2)9-15-10-16-11-17(12-19(26)21(16)24(29)22(15)23(18)28)33-8-7-31-5-6-32-13-20(27)25-30/h10-12,14,18,26,29-30H,3-9,13H2,1-2H3,(H,25,27)/t14-,18+/m1/s1
Standard InChI Key: BDLUCXOSLXWXJE-KDOFPFPSSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
10.3249 -3.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3238 -3.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0318 -4.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0300 -2.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7386 -3.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7394 -3.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4479 -4.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4424 -2.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1515 -3.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1532 -3.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8596 -4.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5688 -3.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5670 -3.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8561 -2.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8602 -5.1849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4516 -5.1928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0337 -5.1989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6171 -2.7447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9095 -3.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2017 -2.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4941 -3.1538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7863 -2.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0787 -3.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3709 -2.7458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6632 -3.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9554 -2.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2478 -3.1549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9552 -1.9289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5400 -2.7464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2743 -2.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2768 -4.3669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9842 -3.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6922 -4.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
11 15 2 0
7 16 1 0
3 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
13 30 1 1
12 31 1 6
31 32 1 0
32 33 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.51Molecular Weight (Monoisotopic): 461.2050AlogP: 2.96#Rotatable Bonds: 11Polar Surface Area: 134.55Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.75CX Basic pKa: ┄CX LogP: 3.45CX LogD: 3.28Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: 0.77
References 1. Murase H,Wakisaka G,Noguchi T,Sasaki S. (2020) Protection of all cleavable sites of DNA with the multiple CGCG or continuous CGG sites from the restriction enzyme, indicative of simultaneous binding of small ligands., 28 (20.0): [PMID:33069073 ] [10.1016/j.bmc.2020.115730 ]