2-[2-[2-[[(6S,7R)-4,10-dihydroxy-7-methyl-5-oxo-6-propyl-7,8-dihydro-6H-anthracen-2-yl]oxy]ethoxy]ethoxy]ethanehydroxamic acid

ID: ALA4743487

PubChem CID: 162645978

Max Phase: Preclinical

Molecular Formula: C24H31NO8

Molecular Weight: 461.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC[C@@H]1C(=O)c2c(cc3cc(OCCOCCOCC(=O)NO)cc(O)c3c2O)C[C@H]1C

Standard InChI:  InChI=1S/C24H31NO8/c1-3-4-18-14(2)9-15-10-16-11-17(12-19(26)21(16)24(29)22(15)23(18)28)33-8-7-31-5-6-32-13-20(27)25-30/h10-12,14,18,26,29-30H,3-9,13H2,1-2H3,(H,25,27)/t14-,18+/m1/s1

Standard InChI Key:  BDLUCXOSLXWXJE-KDOFPFPSSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   10.3249   -3.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3238   -3.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0318   -4.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0300   -2.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7386   -3.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7394   -3.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4479   -4.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4424   -2.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1515   -3.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1532   -3.9619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8596   -4.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5688   -3.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5670   -3.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8561   -2.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8602   -5.1849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4516   -5.1928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0337   -5.1989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6171   -2.7447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9095   -3.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2017   -2.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4941   -3.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7863   -2.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0787   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3709   -2.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6632   -3.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9554   -2.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2478   -3.1549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9552   -1.9289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5400   -2.7464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2743   -2.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2768   -4.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9842   -3.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6922   -4.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 11 15  2  0
  7 16  1  0
  3 17  1  0
  1 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 13 30  1  1
 12 31  1  6
 31 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4743487

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.51Molecular Weight (Monoisotopic): 461.2050AlogP: 2.96#Rotatable Bonds: 11
Polar Surface Area: 134.55Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 3.45CX LogD: 3.28
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: 0.77

References

1. Murase H,Wakisaka G,Noguchi T,Sasaki S.  (2020)  Protection of all cleavable sites of DNA with the multiple CGCG or continuous CGG sites from the restriction enzyme, indicative of simultaneous binding of small ligands.,  28  (20.0): [PMID:33069073] [10.1016/j.bmc.2020.115730]

Source