N-(3-(dimethylamino)propyl)-4-(4-(4-formamido-1-methyl-1H-pyrrole-2-carboxamido)-1-methyl-1H-pyrrole-2-carboxamido)-1-methyl-1H-pyrrole-2-carboxamide hydrochloride

ID: ALA4744205

PubChem CID: 10324792

Max Phase: Preclinical

Molecular Formula: C24H33ClN8O4

Molecular Weight: 496.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc(NC=O)cn3C)cn2C)cn1C.Cl

Standard InChI:  InChI=1S/C24H32N8O4.ClH/c1-29(2)8-6-7-25-22(34)19-10-17(13-31(19)4)27-24(36)21-11-18(14-32(21)5)28-23(35)20-9-16(26-15-33)12-30(20)3;/h9-15H,6-8H2,1-5H3,(H,25,34)(H,26,33)(H,27,36)(H,28,35);1H

Standard InChI Key:  KMVBLWGSHPYXSS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   17.2913   -5.8412    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.2707   -9.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0956   -9.2124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3525   -8.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6832   -7.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0181   -8.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5798   -9.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1375   -8.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7498   -8.7273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3101   -7.3678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0950   -7.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2677   -6.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0527   -6.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2253   -5.2466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2334   -8.1737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6206   -8.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8358   -8.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7925   -9.5329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5807   -7.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7557   -7.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5012   -8.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1688   -8.9596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1705   -9.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2705   -7.0231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4500   -7.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9649   -6.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1149   -7.8636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2177   -5.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5500   -5.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8827   -5.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1381   -6.4451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6545   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5496   -4.3504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8350   -3.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8346   -3.1133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0178   -4.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6072   -4.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  2  0
  3  7  1  0
  4  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  6 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  1  0
 22 23  1  0
 20 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  1  0
 31 32  1  0
 29 33  1  0
 33 34  1  0
 34 35  2  0
 14 36  1  0
 14 37  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 496.57Molecular Weight (Monoisotopic): 496.2547AlogP: 1.46#Rotatable Bonds: 11
Polar Surface Area: 134.43Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.30CX LogP: 0.17CX LogD: -1.72
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -0.65

References

1. Kumari S,Carmona AV,Tiwari AK,Trippier PC.  (2020)  Amide Bond Bioisosteres: Strategies, Synthesis, and Successes.,  63  (21.0): [PMID:32686940] [10.1021/acs.jmedchem.0c00530]

Source