(3S)-3-[3-[[2-(2-chlorophenyl)-4-methyl-thiazol-5-yl]methoxy]phenyl]-3-cyclopropyl-propanoic acid

ID: ALA4746807

PubChem CID: 162648013

Max Phase: Preclinical

Molecular Formula: C23H22ClNO3S

Molecular Weight: 427.95

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2ccccc2Cl)sc1COc1cccc([C@@H](CC(=O)O)C2CC2)c1

Standard InChI:  InChI=1S/C23H22ClNO3S/c1-14-21(29-23(25-14)18-7-2-3-8-20(18)24)13-28-17-6-4-5-16(11-17)19(12-22(26)27)15-9-10-15/h2-8,11,15,19H,9-10,12-13H2,1H3,(H,26,27)/t19-/m0/s1

Standard InChI Key:  QYSVGJYUJZNKRL-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    7.8733   -5.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8722   -6.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5802   -6.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2899   -6.4279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2871   -5.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5784   -5.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9932   -5.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7025   -5.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4086   -5.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1179   -5.5946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4056   -4.3715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9902   -4.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3969   -3.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5797   -3.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1655   -5.2004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1653   -4.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4575   -3.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3759   -3.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5765   -2.9903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1681   -3.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7151   -4.3052    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.9845   -2.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3749   -3.9085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7973   -3.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0047   -3.5338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7896   -4.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3732   -4.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1636   -4.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0123   -2.5356    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  7 12  1  6
 13 12  1  0
 14 13  1  0
 12 14  1  0
  1 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 18 22  1  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 24 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4746807

    ---

Associated Targets(Human)

FFAR2 Tchem Free fatty acid receptor 2 (545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.95Molecular Weight (Monoisotopic): 427.1009AlogP: 6.32#Rotatable Bonds: 8
Polar Surface Area: 59.42Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.53CX Basic pKa: 1.79CX LogP: 5.73CX LogD: 2.94
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -1.00

References

1. Fells JI,Ai X,Weinglass A,Feng W,Lei Y,Finley M,Hoveyda HR,Fraser GL,Machacek M.  (2020)  Identification of free fatty acid receptor 2 agonists using virtual screening.,  30  (21.0): [PMID:32755680] [10.1016/j.bmcl.2020.127460]

Source