Flustraminol G

ID: ALA4752839

PubChem CID: 162652484

Max Phase: Preclinical

Molecular Formula: C22H33BrN2O3

Molecular Weight: 453.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(C)(C)[C@@]12CCN(C)[C@@H]1N(C(OC)C(O)C(C)(C)O)c1cc(Br)ccc12

Standard InChI:  InChI=1S/C22H33BrN2O3/c1-8-20(2,3)22-11-12-24(6)19(22)25(16-13-14(23)9-10-15(16)22)18(28-7)17(26)21(4,5)27/h8-10,13,17-19,26-27H,1,11-12H2,2-7H3/t17?,18?,19-,22-/m1/s1

Standard InChI Key:  XDXPAQBRSJRVAH-OZODEMHJSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   38.4561  -14.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4550  -15.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1630  -15.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1612  -13.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8698  -14.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8746  -14.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6547  -15.2446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6469  -13.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1338  -14.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9100  -14.3183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.9029  -13.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1223  -13.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7469  -15.4087    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   42.5753  -14.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7098  -15.1552    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.2322  -13.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6385  -12.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4150  -13.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8195  -12.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2260  -11.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9114  -16.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3679  -16.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6247  -17.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5677  -16.4651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0812  -18.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4249  -17.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8348  -18.1928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.7117  -16.1859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.9684  -16.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  2 13  1  0
 10 14  1  0
  9 15  1  1
  8 16  1  1
 16 17  1  0
 16 18  1  0
 16 19  1  0
 19 20  2  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  1  0
 23 26  1  0
 23 27  1  0
 21 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4752839

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.42Molecular Weight (Monoisotopic): 452.1675AlogP: 3.49#Rotatable Bonds: 6
Polar Surface Area: 56.17Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.69CX Basic pKa: 6.14CX LogP: 4.33CX LogD: 4.31
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.65Np Likeness Score: 1.54

References

1. Di X,Wang S,Oskarsson JT,Rouger C,Tasdemir D,Hardardottir I,Freysdottir J,Wang X,Molinski TF,Omarsdottir S.  (2020)  Bromotryptamine and Imidazole Alkaloids with Anti-inflammatory Activity from the Bryozoan Flustra foliacea.,  83  (10): [PMID:33016699] [10.1021/acs.jnatprod.0c00126]

Source