5-(4-methoxyphenyl)-7-[2-(4-methoxyphenyl)vinyl]-2-methyl-5H-thiazolo[3,2-a]pyrimidine

ID: ALA4757444

PubChem CID: 162656346

Max Phase: Preclinical

Molecular Formula: C23H22N2O2S

Molecular Weight: 390.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/C2=CC(c3ccc(OC)cc3)N3C=C(C)SC3=N2)cc1

Standard InChI:  InChI=1S/C23H22N2O2S/c1-16-15-25-22(18-7-12-21(27-3)13-8-18)14-19(24-23(25)28-16)9-4-17-5-10-20(26-2)11-6-17/h4-15,22H,1-3H3/b9-4+

Standard InChI Key:  TYKJZNPCWWCYQU-RUDMXATFSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   24.6423   -4.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6411   -5.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3492   -5.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0588   -5.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0560   -4.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3474   -3.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7622   -3.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4714   -4.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1776   -3.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8854   -4.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5895   -3.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1713   -2.9659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2966   -4.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2952   -5.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0021   -5.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7108   -5.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7082   -4.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0007   -3.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8815   -2.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5866   -2.9660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1939   -2.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8642   -1.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0531   -1.7594    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.4190   -5.4149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9331   -5.4291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2257   -5.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4201   -6.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2746   -0.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 12  1  0
 10 11  1  0
 11 20  1  0
 19 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 11 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 16 24  1  0
  2 25  1  0
 25 26  1  0
 24 27  1  0
 22 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4757444

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.51Molecular Weight (Monoisotopic): 390.1402AlogP: 5.62#Rotatable Bonds: 5
Polar Surface Area: 34.06Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.16CX LogP: 4.49CX LogD: 4.49
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -0.14

References

1. Al-Rashood ST,Elshahawy SS,El-Qaias AM,El-Behedy DS,Hassanin AA,El-Sayed SM,El-Messery SM,Shaldam MA,Hassan GS.  (2020)  New thiazolopyrimidine as anticancer agents: Synthesis, biological evaluation, DNA binding, molecular modeling and ADMET study.,  30  (23.0): [PMID:33068712] [10.1016/j.bmcl.2020.127611]

Source