The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(dimethylamino)propyl)-1-methyl-4-(1-methyl-4-(1-methyl-4-nitro-1H-pyrrole-2-carboxamido)-1H-pyrrole-2-carboxamido)-1H-pyrrole-2-carboxamide hydrochloride ID: ALA4758715
PubChem CID: 10324848
Max Phase: Preclinical
Molecular Formula: C23H31ClN8O5
Molecular Weight: 498.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc([N+](=O)[O-])cn3C)cn2C)cn1C.Cl
Standard InChI: InChI=1S/C23H30N8O5.ClH/c1-27(2)8-6-7-24-21(32)18-9-15(12-28(18)3)25-22(33)19-10-16(13-29(19)4)26-23(34)20-11-17(31(35)36)14-30(20)5;/h9-14H,6-8H2,1-5H3,(H,24,32)(H,25,33)(H,26,34);1H
Standard InChI Key: HUPDDIXFGOHDJZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
16.4284 -4.2814 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.2707 -9.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0956 -9.2124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3525 -8.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6832 -7.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0181 -8.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5798 -9.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1375 -8.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7498 -8.7273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3101 -7.3678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0950 -7.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2677 -6.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0527 -6.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2253 -5.2466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2334 -8.1737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6206 -8.7260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8358 -8.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7925 -9.5329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5807 -7.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7557 -7.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5012 -8.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1688 -8.9596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1705 -9.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2705 -7.0231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4500 -7.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9649 -6.4425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1149 -7.8636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2177 -5.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5500 -5.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8827 -5.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1381 -6.4451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6545 -7.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6130 -4.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0103 -4.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5462 -4.3479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8315 -3.9357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2605 -3.9351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 2 0
3 7 1 0
4 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
6 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 1 0
22 23 1 0
20 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 26 1 0
31 32 1 0
14 33 1 0
14 34 1 0
35 36 2 0
35 37 1 0
29 35 1 0
M CHG 2 35 1 37 -1
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.54Molecular Weight (Monoisotopic): 498.2339AlogP: 1.80#Rotatable Bonds: 10Polar Surface Area: 148.47Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.30CX LogP: 0.92CX LogD: -0.97Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: -1.00