The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-(tert-butyl)-1-(2-methoxyquinoline-4-carbonyl)-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazol]-7'(6'H)-one ID: ALA4761180
PubChem CID: 155664273
Max Phase: Preclinical
Molecular Formula: C25H28N4O4
Molecular Weight: 448.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)N2CCC3(CC2)CC(=O)c2nn(C(C)(C)C)cc2O3)c2ccccc2n1
Standard InChI: InChI=1S/C25H28N4O4/c1-24(2,3)29-15-20-22(27-29)19(30)14-25(33-20)9-11-28(12-10-25)23(31)17-13-21(32-4)26-18-8-6-5-7-16(17)18/h5-8,13,15H,9-12,14H2,1-4H3
Standard InChI Key: QUDXZRCSJDRAQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
7.0576 -19.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0534 -19.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3476 -18.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3558 -20.3696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8874 -19.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8863 -20.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3012 -19.9556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5925 -19.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3040 -20.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5935 -21.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5920 -22.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3002 -22.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0114 -22.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0094 -21.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1786 -21.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4709 -20.7789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1787 -22.0046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4747 -19.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7710 -19.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0591 -20.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7673 -21.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3446 -17.9180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6455 -19.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6426 -19.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8639 -18.8944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3855 -19.5578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8685 -20.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5683 -19.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1572 -18.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1622 -20.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7487 -19.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5901 -18.7332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2966 -18.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 24 1 0
23 4 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
6 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 21 1 0
18 19 1 0
19 1 1 0
1 20 1 0
20 21 1 0
3 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 23 2 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
8 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.2111AlogP: 3.84#Rotatable Bonds: 2Polar Surface Area: 86.55Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.77CX LogP: 2.81CX LogD: 2.81Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: -1.10
References 1. Huang T,Wu X,Yan S,Liu T,Yin X. (2021) Synthesis and in vitro evaluation of novel spiroketopyrazoles as acetyl-CoA carboxylase inhibitors and potential antitumor agents., 212 [PMID:33276990 ] [10.1016/j.ejmech.2020.113036 ]