The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[[4-[2-oxo-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethoxy]phenyl]methylene]thiazolidine-2,4-dione ID: ALA4762532
PubChem CID: 46947466
Max Phase: Preclinical
Molecular Formula: C19H12N2O7S2
Molecular Weight: 444.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C/c2ccc(OCC(=O)N3C(=O)c4ccccc4S3(=O)=O)cc2)S1
Standard InChI: InChI=1S/C19H12N2O7S2/c22-16(21-18(24)13-3-1-2-4-15(13)30(21,26)27)10-28-12-7-5-11(6-8-12)9-14-17(23)20-19(25)29-14/h1-9H,10H2,(H,20,23,25)/b14-9-
Standard InChI Key: WYOFBYLBNYHOQF-ZROIWOOFSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
17.2271 -17.5242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0166 -18.3166 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.8081 -18.1027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9496 -18.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9485 -19.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6606 -19.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3703 -19.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3675 -18.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6588 -17.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0778 -17.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7911 -18.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8787 -19.1195 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.6829 -19.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0929 -18.5771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5396 -17.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0222 -20.0399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7060 -17.1636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2363 -19.5483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5248 -19.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8126 -19.5472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1011 -19.1339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8120 -20.3685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3488 -19.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1778 -20.2679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7997 -18.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2148 -18.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8101 -17.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9904 -17.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5771 -18.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9842 -18.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
13 16 2 0
15 17 2 0
5 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 2 1 0
2 26 1 0
25 23 1 0
23 21 1 0
23 24 2 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.45Molecular Weight (Monoisotopic): 444.0086AlogP: 1.76#Rotatable Bonds: 4Polar Surface Area: 126.92Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.20CX Basic pKa: ┄CX LogP: 1.83CX LogD: 0.68Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: -1.26
References 1. Joshi H,Patil V,Tilekar K,Upadhyay N,Gota V,Ramaa CS. (2020) Benzylidene thiazolidinediones: Synthesis, in vitro investigations of antiproliferative mechanisms and in vivo efficacy determination in combination with Imatinib., 30 (23.0): [PMID:32961322 ] [10.1016/j.bmcl.2020.127561 ]