The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-(tert-butyl)-1-(2-(4-(dimethylamino)phenyl)quinoline-4-carbonyl)-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazol]-7'(6'H)-one ID: ALA4777090
PubChem CID: 155664261
Max Phase: Preclinical
Molecular Formula: C32H35N5O3
Molecular Weight: 537.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(-c2cc(C(=O)N3CCC4(CC3)CC(=O)c3nn(C(C)(C)C)cc3O4)c3ccccc3n2)cc1
Standard InChI: InChI=1S/C32H35N5O3/c1-31(2,3)37-20-28-29(34-37)27(38)19-32(40-28)14-16-36(17-15-32)30(39)24-18-26(33-25-9-7-6-8-23(24)25)21-10-12-22(13-11-21)35(4)5/h6-13,18,20H,14-17,19H2,1-5H3
Standard InChI Key: RFXZDAJIYKJWCO-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
23.4385 -28.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4344 -28.0652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7286 -27.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7368 -29.2968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2684 -28.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2672 -29.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6821 -28.8828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9735 -28.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6850 -29.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9745 -30.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9729 -30.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6811 -31.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3923 -30.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3904 -30.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5596 -30.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8518 -29.7061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5597 -30.9318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8557 -28.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1520 -28.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4400 -29.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1482 -30.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7256 -26.8452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0264 -28.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0236 -28.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2449 -27.8216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7664 -28.4850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2495 -29.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9492 -28.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5381 -27.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5431 -29.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1297 -28.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9683 -27.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6764 -27.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6743 -26.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9648 -26.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2560 -26.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2616 -27.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9613 -25.2122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6672 -24.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2518 -24.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 24 1 0
23 4 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
6 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 21 1 0
18 19 1 0
19 1 1 0
1 20 1 0
20 21 1 0
3 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 23 2 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
8 32 1 0
35 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.66Molecular Weight (Monoisotopic): 537.2740AlogP: 5.56#Rotatable Bonds: 3Polar Surface Area: 80.56Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.28CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: -1.22
References 1. Huang T,Wu X,Yan S,Liu T,Yin X. (2021) Synthesis and in vitro evaluation of novel spiroketopyrazoles as acetyl-CoA carboxylase inhibitors and potential antitumor agents., 212 [PMID:33276990 ] [10.1016/j.ejmech.2020.113036 ]