The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-8,9-dihydroxy-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-methyl-2-propyl-3,4-dihydro-2H-anthracen-1-one ID: ALA4780143
PubChem CID: 162663303
Max Phase: Preclinical
Molecular Formula: C25H34O7
Molecular Weight: 446.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@@H]1C(=O)c2c(cc3cc(OCCOCCOCCOC)cc(O)c3c2O)C[C@H]1C
Standard InChI: InChI=1S/C25H34O7/c1-4-5-20-16(2)12-17-13-18-14-19(32-11-10-31-9-8-30-7-6-29-3)15-21(26)22(18)25(28)23(17)24(20)27/h13-16,20,26,28H,4-12H2,1-3H3/t16-,20+/m1/s1
Standard InChI Key: IIBBILDAVNWBEA-UZLBHIALSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
28.8441 -10.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8429 -11.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5577 -11.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5559 -9.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2713 -10.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2721 -11.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9874 -11.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9817 -9.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6976 -10.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6994 -11.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4125 -11.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1285 -11.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1267 -10.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4090 -9.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4131 -12.2510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9911 -12.2590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5597 -12.2651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1295 -9.7875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4152 -10.2002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7006 -9.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9863 -10.2005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2716 -9.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5573 -10.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8427 -9.7885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1284 -10.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4138 -9.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8407 -9.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8433 -11.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5574 -11.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2722 -11.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6995 -10.2015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9849 -9.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
11 15 2 0
7 16 1 0
3 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
13 27 1 1
12 28 1 6
28 29 1 0
29 30 1 0
26 31 1 0
31 32 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.54Molecular Weight (Monoisotopic): 446.2305AlogP: 4.10#Rotatable Bonds: 12Polar Surface Area: 94.45Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.81CX Basic pKa: ┄CX LogP: 4.73CX LogD: 4.59Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: 0.88
References 1. Murase H,Wakisaka G,Noguchi T,Sasaki S. (2020) Protection of all cleavable sites of DNA with the multiple CGCG or continuous CGG sites from the restriction enzyme, indicative of simultaneous binding of small ligands., 28 (20.0): [PMID:33069073 ] [10.1016/j.bmc.2020.115730 ]